- remove obsolete svn '$Id$' tags from all source files - update .fl files and generated files accordingly - replace 'http://www.fltk.org' URL's with 'https://...' - replace bug report URL 'str.php' with 'bugs.php' - remove trailing whitespace - fix other whitespace errors flagged by Git - add and/or fix missing or wrong standard headers - convert tabs to spaces in all source files The only relevant code changes are in the fluid/ folder where some .fl files and other source files were used to generate the '$Id' headers and footers.
450 lines
16 KiB
C++
450 lines
16 KiB
C++
//
|
|
// Scroll widget for the Fast Light Tool Kit (FLTK).
|
|
//
|
|
// Copyright 1998-2017 by Bill Spitzak and others.
|
|
//
|
|
// This library is free software. Distribution and use rights are outlined in
|
|
// the file "COPYING" which should have been included with this file. If this
|
|
// file is missing or damaged, see the license at:
|
|
//
|
|
// https://www.fltk.org/COPYING.php
|
|
//
|
|
// Please see the following page on how to report bugs and issues:
|
|
//
|
|
// https://www.fltk.org/bugs.php
|
|
//
|
|
|
|
#include <FL/Fl.H>
|
|
#include <FL/Fl_Tiled_Image.H>
|
|
#include <FL/Fl_Scroll.H>
|
|
#include <FL/fl_draw.H>
|
|
|
|
/** Clear all but the scrollbars... */
|
|
void Fl_Scroll::clear() {
|
|
// Note: the scrollbars are removed from the group before calling
|
|
// Fl_Group::clear() to take advantage of the optimized widget removal
|
|
// and deletion. Finally they are added to Fl_Scroll's group again. This
|
|
// is MUCH faster than removing the widgets one by one (STR #2409).
|
|
|
|
remove(scrollbar);
|
|
remove(hscrollbar);
|
|
Fl_Group::clear();
|
|
add(hscrollbar);
|
|
add(scrollbar);
|
|
}
|
|
|
|
/** Insure the scrollbars are the last children. */
|
|
void Fl_Scroll::fix_scrollbar_order() {
|
|
Fl_Widget** a = (Fl_Widget**)array();
|
|
if (a[children()-1] != &scrollbar) {
|
|
int i,j; for (i = j = 0; j < children(); j++)
|
|
if (a[j] != &hscrollbar && a[j] != &scrollbar) a[i++] = a[j];
|
|
a[i++] = &hscrollbar;
|
|
a[i++] = &scrollbar;
|
|
}
|
|
}
|
|
|
|
// Draw widget's background and children within a specific clip region
|
|
// So widget can just redraw damaged parts.
|
|
//
|
|
void Fl_Scroll::draw_clip(void* v,int X, int Y, int W, int H) {
|
|
fl_push_clip(X,Y,W,H);
|
|
Fl_Scroll* s = (Fl_Scroll*)v;
|
|
// erase background as needed...
|
|
switch (s->box()) {
|
|
case FL_NO_BOX :
|
|
case FL_UP_FRAME :
|
|
case FL_DOWN_FRAME :
|
|
case FL_THIN_UP_FRAME :
|
|
case FL_THIN_DOWN_FRAME :
|
|
case FL_ENGRAVED_FRAME :
|
|
case FL_EMBOSSED_FRAME :
|
|
case FL_BORDER_FRAME :
|
|
case _FL_SHADOW_FRAME :
|
|
case _FL_ROUNDED_FRAME :
|
|
case _FL_OVAL_FRAME :
|
|
case _FL_PLASTIC_UP_FRAME :
|
|
case _FL_PLASTIC_DOWN_FRAME :
|
|
if (s->parent() == (Fl_Group *)s->window() && Fl::scheme_bg_) {
|
|
Fl::scheme_bg_->draw(X-(X%((Fl_Tiled_Image *)Fl::scheme_bg_)->image()->w()),
|
|
Y-(Y%((Fl_Tiled_Image *)Fl::scheme_bg_)->image()->h()),
|
|
W+((Fl_Tiled_Image *)Fl::scheme_bg_)->image()->w(),
|
|
H+((Fl_Tiled_Image *)Fl::scheme_bg_)->image()->h());
|
|
break;
|
|
}
|
|
|
|
default :
|
|
fl_color(s->color());
|
|
fl_rectf(X,Y,W,H);
|
|
break;
|
|
}
|
|
Fl_Widget*const* a = s->array();
|
|
for (int i=s->children()-2; i--;) {
|
|
Fl_Widget& o = **a++;
|
|
s->draw_child(o);
|
|
s->draw_outside_label(o);
|
|
}
|
|
fl_pop_clip();
|
|
}
|
|
|
|
/**
|
|
Calculate visibility/size/position of scrollbars, find children's bounding box.
|
|
|
|
The \p si parameter will be filled with data from the calculations.
|
|
Derived classes can make use of this call to figure out the scrolling area
|
|
eg. during resize() handling.
|
|
|
|
\param[in] si -- ScrollInfo structure
|
|
\returns Structure containing the calculated info.
|
|
*/
|
|
void Fl_Scroll::recalc_scrollbars(ScrollInfo &si) {
|
|
|
|
// inner box of widget (excluding scrollbars)
|
|
si.innerbox.x = x()+Fl::box_dx(box());
|
|
si.innerbox.y = y()+Fl::box_dy(box());
|
|
si.innerbox.w = w()-Fl::box_dw(box());
|
|
si.innerbox.h = h()-Fl::box_dh(box());
|
|
|
|
// accumulate a bounding box for all the children
|
|
si.child.l = si.innerbox.x;
|
|
si.child.r = si.innerbox.x;
|
|
si.child.b = si.innerbox.y;
|
|
si.child.t = si.innerbox.y;
|
|
int first = 1;
|
|
Fl_Widget*const* a = array();
|
|
for (int i=children(); i--;) {
|
|
Fl_Widget* o = *a++;
|
|
if ( o==&scrollbar || o==&hscrollbar ) continue;
|
|
if ( first ) {
|
|
first = 0;
|
|
si.child.l = o->x();
|
|
si.child.r = o->x()+o->w();
|
|
si.child.b = o->y()+o->h();
|
|
si.child.t = o->y();
|
|
} else {
|
|
if (o->x() < si.child.l) si.child.l = o->x();
|
|
if (o->y() < si.child.t) si.child.t = o->y();
|
|
if (o->x()+o->w() > si.child.r) si.child.r = o->x()+o->w();
|
|
if (o->y()+o->h() > si.child.b) si.child.b = o->y()+o->h();
|
|
}
|
|
}
|
|
|
|
// Turn the scrollbars on and off as necessary.
|
|
// See if children would fit if we had no scrollbars...
|
|
{
|
|
int X = si.innerbox.x;
|
|
int Y = si.innerbox.y;
|
|
int W = si.innerbox.w;
|
|
int H = si.innerbox.h;
|
|
|
|
si.scrollsize = scrollbar_size_ ? scrollbar_size_ : Fl::scrollbar_size();
|
|
si.vneeded = 0;
|
|
si.hneeded = 0;
|
|
if (type() & VERTICAL) {
|
|
if ((type() & ALWAYS_ON) || si.child.t < Y || si.child.b > Y+H) {
|
|
si.vneeded = 1;
|
|
W -= si.scrollsize;
|
|
if (scrollbar.align() & FL_ALIGN_LEFT) X += si.scrollsize;
|
|
}
|
|
}
|
|
if (type() & HORIZONTAL) {
|
|
if ((type() & ALWAYS_ON) || si.child.l < X || si.child.r > X+W) {
|
|
si.hneeded = 1;
|
|
H -= si.scrollsize;
|
|
if (scrollbar.align() & FL_ALIGN_TOP) Y += si.scrollsize;
|
|
// recheck vertical since we added a horizontal scrollbar
|
|
if (!si.vneeded && (type() & VERTICAL)) {
|
|
if ((type() & ALWAYS_ON) || si.child.t < Y || si.child.b > Y+H) {
|
|
si.vneeded = 1;
|
|
W -= si.scrollsize;
|
|
if (scrollbar.align() & FL_ALIGN_LEFT) X += si.scrollsize;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
si.innerchild.x = X;
|
|
si.innerchild.y = Y;
|
|
si.innerchild.w = W;
|
|
si.innerchild.h = H;
|
|
}
|
|
|
|
// calculate hor scrollbar position
|
|
si.hscroll.x = si.innerchild.x;
|
|
si.hscroll.y = (scrollbar.align() & FL_ALIGN_TOP)
|
|
? si.innerbox.y
|
|
: si.innerbox.y + si.innerbox.h - si.scrollsize;
|
|
si.hscroll.w = si.innerchild.w;
|
|
si.hscroll.h = si.scrollsize;
|
|
|
|
// calculate ver scrollbar position
|
|
si.vscroll.x = (scrollbar.align() & FL_ALIGN_LEFT)
|
|
? si.innerbox.x
|
|
: si.innerbox.x + si.innerbox.w - si.scrollsize;
|
|
si.vscroll.y = si.innerchild.y;
|
|
si.vscroll.w = si.scrollsize;
|
|
si.vscroll.h = si.innerchild.h;
|
|
|
|
// calculate h/v scrollbar values (pos/size/first/total)
|
|
si.hscroll.pos = si.innerchild.x - si.child.l;
|
|
si.hscroll.size = si.innerchild.w;
|
|
si.hscroll.first = 0;
|
|
si.hscroll.total = si.child.r - si.child.l;
|
|
if ( si.hscroll.pos < 0 ) { si.hscroll.total += (-si.hscroll.pos); si.hscroll.first = si.hscroll.pos; }
|
|
|
|
si.vscroll.pos = si.innerchild.y - si.child.t;
|
|
si.vscroll.size = si.innerchild.h;
|
|
si.vscroll.first = 0;
|
|
si.vscroll.total = si.child.b - si.child.t;
|
|
if ( si.vscroll.pos < 0 ) { si.vscroll.total += (-si.vscroll.pos); si.vscroll.first = si.vscroll.pos; }
|
|
|
|
// printf("DEBUG --- ScrollInfo ---\n");
|
|
// printf("DEBUG scrollsize: %d\n", si.scrollsize);
|
|
// printf("DEBUG hneeded, vneeded: %d %d\n", si.hneeded, si.vneeded);
|
|
// printf("DEBUG innerbox.x, si.innerbox.y, si.innerbox.w,si.innerbox.h);
|
|
// printf("DEBUG innerchild.xywh: %d %d %d %d\n", si.innerchild.x, si.innerchild.y, si.innerchild.w, si.innerchild.h);
|
|
// printf("DEBUG child lrbt: %d %d %d %d\n", si.child.l, si.child.r, si.child.b, si.child.t);
|
|
// printf("DEBUG hscroll xywh: %d %d %d %d\n", si.hscroll.x, si.hscroll.y, si.hscroll.w, si.hscroll.h);
|
|
// printf("DEBUG vscroll xywh: %d %d %d %d\n", si.vscroll.x, si.vscroll.y, si.vscroll.w, si.vscroll.h);
|
|
// printf("DEBUG horz scroll vals: %d %d %d %d\n", si.hscroll.pos, si.hscroll.size, si.hscroll.first, si.hscroll.total);
|
|
// printf("DEBUG vert scroll vals: %d %d %d %d\n", si.vscroll.pos, si.vscroll.size, si.vscroll.first, si.vscroll.total);
|
|
// printf("DEBUG \n");
|
|
}
|
|
|
|
/**
|
|
Returns the bounding box for the interior of the scrolling area, inside
|
|
the scrollbars.
|
|
|
|
Currently this is only reliable after draw(), and before any resizing of
|
|
the Fl_Scroll or any child widgets occur.
|
|
|
|
\todo The visibility of the scrollbars ought to be checked/calculated
|
|
outside of the draw() method (STR #1895).
|
|
*/
|
|
void Fl_Scroll::bbox(int& X, int& Y, int& W, int& H) {
|
|
X = x()+Fl::box_dx(box());
|
|
Y = y()+Fl::box_dy(box());
|
|
W = w()-Fl::box_dw(box());
|
|
H = h()-Fl::box_dh(box());
|
|
if (scrollbar.visible()) {
|
|
W -= scrollbar.w();
|
|
if (scrollbar.align() & FL_ALIGN_LEFT) X += scrollbar.w();
|
|
}
|
|
if (hscrollbar.visible()) {
|
|
H -= hscrollbar.h();
|
|
if (scrollbar.align() & FL_ALIGN_TOP) Y += hscrollbar.h();
|
|
}
|
|
}
|
|
|
|
void Fl_Scroll::draw() {
|
|
fix_scrollbar_order();
|
|
int X,Y,W,H; bbox(X,Y,W,H);
|
|
|
|
uchar d = damage();
|
|
|
|
float scale = Fl_Surface_Device::surface()->driver()->scale();
|
|
if ((d & FL_DAMAGE_ALL) || scale != int(scale)) { // full redraw
|
|
draw_box(box(),x(),y(),w(),h(),color());
|
|
draw_clip(this, X, Y, W, H);
|
|
} else {
|
|
if (d & FL_DAMAGE_SCROLL) {
|
|
// scroll the contents:
|
|
fl_scroll(X, Y, W, H, oldx-xposition_, oldy-yposition_, draw_clip, this);
|
|
|
|
// Erase the background as needed...
|
|
Fl_Widget*const* a = array();
|
|
int L, R, T, B;
|
|
L = 999999;
|
|
R = 0;
|
|
T = 999999;
|
|
B = 0;
|
|
for (int i=children()-2; i--; a++) {
|
|
if ((*a)->x() < L) L = (*a)->x();
|
|
if (((*a)->x() + (*a)->w()) > R) R = (*a)->x() + (*a)->w();
|
|
if ((*a)->y() < T) T = (*a)->y();
|
|
if (((*a)->y() + (*a)->h()) > B) B = (*a)->y() + (*a)->h();
|
|
}
|
|
if (L > X) draw_clip(this, X, Y, L - X, H);
|
|
if (R < (X + W)) draw_clip(this, R, Y, X + W - R, H);
|
|
if (T > Y) draw_clip(this, X, Y, W, T - Y);
|
|
if (B < (Y + H)) draw_clip(this, X, B, W, Y + H - B);
|
|
}
|
|
if (d & FL_DAMAGE_CHILD) { // draw damaged children
|
|
fl_push_clip(X, Y, W, H);
|
|
Fl_Widget*const* a = array();
|
|
for (int i=children()-2; i--;) update_child(**a++);
|
|
fl_pop_clip();
|
|
}
|
|
}
|
|
|
|
// Calculate where scrollbars should go, and draw them
|
|
{
|
|
ScrollInfo si;
|
|
recalc_scrollbars(si);
|
|
|
|
// Now that we know what's needed, make it so.
|
|
if (si.vneeded && !scrollbar.visible()) {
|
|
scrollbar.set_visible();
|
|
d = FL_DAMAGE_ALL;
|
|
}
|
|
else if (!si.vneeded && scrollbar.visible()) {
|
|
scrollbar.clear_visible();
|
|
draw_clip(this, si.vscroll.x, si.vscroll.y, si.vscroll.w, si.vscroll.h);
|
|
d = FL_DAMAGE_ALL;
|
|
}
|
|
if (si.hneeded && !hscrollbar.visible()) {
|
|
hscrollbar.set_visible();
|
|
d = FL_DAMAGE_ALL;
|
|
}
|
|
else if (!si.hneeded && hscrollbar.visible()) {
|
|
hscrollbar.clear_visible();
|
|
draw_clip(this, si.hscroll.x, si.hscroll.y, si.hscroll.w, si.hscroll.h);
|
|
d = FL_DAMAGE_ALL;
|
|
}
|
|
else if ( hscrollbar.h() != si.scrollsize || scrollbar.w() != si.scrollsize ) {
|
|
// scrollsize changed
|
|
d = FL_DAMAGE_ALL;
|
|
}
|
|
|
|
scrollbar.resize(si.vscroll.x, si.vscroll.y, si.vscroll.w, si.vscroll.h);
|
|
oldy = yposition_ = si.vscroll.pos; // si.innerchild.y - si.child.t;
|
|
scrollbar.value(si.vscroll.pos, si.vscroll.size, si.vscroll.first, si.vscroll.total);
|
|
|
|
hscrollbar.resize(si.hscroll.x, si.hscroll.y, si.hscroll.w, si.hscroll.h);
|
|
oldx = xposition_ = si.hscroll.pos; // si.innerchild.x - si.child.l;
|
|
hscrollbar.value(si.hscroll.pos, si.hscroll.size, si.hscroll.first, si.hscroll.total);
|
|
}
|
|
|
|
// draw the scrollbars:
|
|
if (d & FL_DAMAGE_ALL) {
|
|
draw_child(scrollbar);
|
|
draw_child(hscrollbar);
|
|
if (scrollbar.visible() && hscrollbar.visible()) {
|
|
// fill in the little box in the corner
|
|
fl_color(color());
|
|
fl_rectf(scrollbar.x(), hscrollbar.y(), scrollbar.w(), hscrollbar.h());
|
|
}
|
|
} else {
|
|
update_child(scrollbar);
|
|
update_child(hscrollbar);
|
|
}
|
|
}
|
|
|
|
/**
|
|
Resizes the Fl_Scroll widget and moves its children if necessary.
|
|
|
|
The Fl_Scroll widget first resizes itself, and then it moves all its
|
|
children if (and only if) the Fl_Scroll widget has been moved. The
|
|
children are moved by the same amount as the Fl_Scroll widget has been
|
|
moved, hence all children keep their relative positions.
|
|
|
|
\note Fl_Scroll::resize() does \b not call Fl_Group::resize(), and
|
|
child widgets are \b not resized.
|
|
|
|
Since children of an Fl_Scroll are not resized, the resizable() widget
|
|
is ignored (if it is set).
|
|
|
|
The scrollbars are moved to their proper positions, as given by
|
|
Fl_Scroll::scrollbar.align(), and switched on or off as necessary.
|
|
|
|
\note Due to current (FLTK 1.3.x) implementation constraints some of this
|
|
may effectively be postponed until the Fl_Scroll is drawn the next time.
|
|
This may change in a future release.
|
|
|
|
\sa Fl_Group::resizable()
|
|
\sa Fl_Widget::resize(int,int,int,int)
|
|
*/
|
|
void Fl_Scroll::resize(int X, int Y, int W, int H) {
|
|
int dx = X-x(), dy = Y-y();
|
|
int dw = W-w(), dh = H-h();
|
|
Fl_Widget::resize(X,Y,W,H); // resize _before_ moving children around
|
|
fix_scrollbar_order();
|
|
// move all the children:
|
|
Fl_Widget*const* a = array();
|
|
for (int i=children()-2; i--;) {
|
|
Fl_Widget* o = *a++;
|
|
o->position(o->x()+dx, o->y()+dy);
|
|
}
|
|
if (dw==0 && dh==0) {
|
|
char pad = ( scrollbar.visible() && hscrollbar.visible() );
|
|
char al = ( (scrollbar.align() & FL_ALIGN_LEFT) != 0 );
|
|
char at = ( (scrollbar.align() & FL_ALIGN_TOP) !=0 );
|
|
scrollbar.position(al?X:X+W-scrollbar.w(), (at&&pad)?Y+hscrollbar.h():Y);
|
|
hscrollbar.position((al&&pad)?X+scrollbar.w():X, at?Y:Y+H-hscrollbar.h());
|
|
} else {
|
|
// FIXME recalculation of scrollbars needs to be moved out of "draw()" (STR #1895)
|
|
redraw(); // need full recalculation of scrollbars
|
|
}
|
|
}
|
|
|
|
/** Moves the contents of the scroll group to a new position.
|
|
|
|
This is like moving the scrollbars of the Fl_Scroll around. For instance:
|
|
\code
|
|
Fl_Scroll scroll (10,10,200,200);
|
|
Fl_Box b1 ( 10, 10,50,50,"b1"); // relative (x,y) = (0,0)
|
|
Fl_Box b2 ( 60, 60,50,50,"b2"); // relative (x,y) = (50,50)
|
|
Fl_Box b3 ( 60,110,50,50,"b3"); // relative (x,y) = (50,100)
|
|
// populate scroll with more children ...
|
|
scroll.end();
|
|
scroll.scroll_to(50,100);
|
|
\endcode
|
|
will move the logical origin of the internal scroll area to (-50,-100)
|
|
relative to the origin of the Fl_Scroll (10,10), i.e. Fl_Box b3 will
|
|
be visible in the top left corner of the scroll area.
|
|
*/
|
|
void Fl_Scroll::scroll_to(int X, int Y) {
|
|
int dx = xposition_-X;
|
|
int dy = yposition_-Y;
|
|
if (!dx && !dy) return;
|
|
xposition_ = X;
|
|
yposition_ = Y;
|
|
Fl_Widget*const* a = array();
|
|
for (int i=children(); i--;) {
|
|
Fl_Widget* o = *a++;
|
|
if (o == &hscrollbar || o == &scrollbar) continue;
|
|
o->position(o->x()+dx, o->y()+dy);
|
|
}
|
|
if (parent() == (Fl_Group *)window() && Fl::scheme_bg_) damage(FL_DAMAGE_ALL);
|
|
else damage(FL_DAMAGE_SCROLL);
|
|
}
|
|
|
|
void Fl_Scroll::hscrollbar_cb(Fl_Widget* o, void*) {
|
|
Fl_Scroll* s = (Fl_Scroll*)(o->parent());
|
|
s->scroll_to(int(((Fl_Scrollbar*)o)->value()), s->yposition());
|
|
}
|
|
|
|
void Fl_Scroll::scrollbar_cb(Fl_Widget* o, void*) {
|
|
Fl_Scroll* s = (Fl_Scroll*)(o->parent());
|
|
s->scroll_to(s->xposition(), int(((Fl_Scrollbar*)o)->value()));
|
|
}
|
|
/**
|
|
Creates a new Fl_Scroll widget using the given position,
|
|
size, and label string. The default boxtype is FL_NO_BOX.
|
|
|
|
The destructor <I>also deletes all the children</I>. This allows a
|
|
whole tree to be deleted at once, without having to keep a pointer to
|
|
all the children in the user code. A kludge has been done so the
|
|
Fl_Scroll and all of its children can be automatic (local)
|
|
variables, but you must declare the Fl_Scroll <I>first</I>, so
|
|
that it is destroyed last.
|
|
*/
|
|
Fl_Scroll::Fl_Scroll(int X,int Y,int W,int H,const char* L)
|
|
: Fl_Group(X,Y,W,H,L),
|
|
scrollbar(X+W-Fl::scrollbar_size(),Y,
|
|
Fl::scrollbar_size(),H-Fl::scrollbar_size()),
|
|
hscrollbar(X,Y+H-Fl::scrollbar_size(),
|
|
W-Fl::scrollbar_size(),Fl::scrollbar_size()) {
|
|
type(BOTH);
|
|
xposition_ = oldx = 0;
|
|
yposition_ = oldy = 0;
|
|
scrollbar_size_ = 0;
|
|
hscrollbar.type(FL_HORIZONTAL);
|
|
hscrollbar.callback(hscrollbar_cb);
|
|
scrollbar.callback(scrollbar_cb);
|
|
}
|
|
|
|
int Fl_Scroll::handle(int event) {
|
|
fix_scrollbar_order();
|
|
return Fl_Group::handle(event);
|
|
}
|