Updated the Fluid IDE support for the current source file structure. Changed the Fl_Tree rendering code around a bit to make the tree more like MSWindows on Windows and more like Apple on Apple machines. I hope you guys like it. I also moved the function to load Fl_Preferences into an Fl_Tree into the Fl_Tree class where it belongs.
git-svn-id: file:///fltk/svn/fltk/branches/branch-1.3@7672 ea41ed52-d2ee-0310-a9c1-e6b18d33e121
This commit is contained in:
parent
8306c3d0b3
commit
32716d6b1e
@ -151,7 +151,7 @@ class FL_EXPORT Fl_Input_ : public Fl_Widget {
|
||||
/** \internal Horizontal cursor position in pixels while movin up or down. */
|
||||
static double up_down_pos;
|
||||
|
||||
/** \internal Flag to remeber last cursor move. */
|
||||
/** \internal Flag to remember last cursor move. */
|
||||
static int was_up_down;
|
||||
|
||||
/* Convert a given text segment into the text that will be rendered on screen. */
|
||||
|
||||
@ -156,7 +156,7 @@ public:
|
||||
// char export( const char *filename, Type fileFormat );
|
||||
// char import( const char *filename );
|
||||
|
||||
char copyTo(class Fl_Tree*);
|
||||
// char copyTo(class Fl_Tree*); // deprecated, use Fl_Tree::load(Fl_Preferences&)
|
||||
|
||||
/**
|
||||
'Name' provides a simple method to create numerical or more complex
|
||||
@ -227,7 +227,6 @@ private:
|
||||
public:
|
||||
Node( const char *path );
|
||||
~Node();
|
||||
char copyTo(class Fl_Tree*, class Fl_Tree_Item*);
|
||||
// node methods
|
||||
int write( FILE *f );
|
||||
const char *name();
|
||||
|
||||
@ -688,6 +688,8 @@ public:
|
||||
void selectmode(Fl_Tree_Select val) {
|
||||
_prefs.selectmode(val);
|
||||
}
|
||||
|
||||
void load(class Fl_Preferences&);
|
||||
};
|
||||
|
||||
#endif /*FL_TREE_H*/
|
||||
|
||||
2
Makefile
2
Makefile
@ -3,7 +3,7 @@
|
||||
#
|
||||
# Top-level makefile for the Fast Light Tool Kit (FLTK).
|
||||
#
|
||||
# Copyright 1998-2009 by Bill Spitzak and others.
|
||||
# Copyright 1998-2010 by Bill Spitzak and others.
|
||||
#
|
||||
# This library is free software; you can redistribute it and/or
|
||||
# modify it under the terms of the GNU Library General Public
|
||||
|
||||
43
fltk.db
43
fltk.db
@ -932,6 +932,7 @@ xcBuildFileID:9DD7A2B6D63D30C07781F446
|
||||
|
||||
refUUID:81A99CD2-985D-4B34-A385-DA2DF36B25C7
|
||||
(filename):src/Fl_Paged_Device.cxx
|
||||
xcBuildFileID:299CB8A2848CB844BCEC7829
|
||||
|
||||
[./targets/libs/FCA55664-7065-436F-B7F2-7F7A397ED739/headers]
|
||||
|
||||
@ -1290,12 +1291,6 @@ refUUID:A3D03C3D-FB0C-4D14-8AF8-96086624A44E
|
||||
(filename):FL/Fl_Overlay_Window.H
|
||||
xcCopyHeaderID:012DC7566408D3CBF672BE50
|
||||
|
||||
[./targets/libs/FCA55664-7065-436F-B7F2-7F7A397ED739/headers/E4711E48-2B85-4DAB-BB3B-9DDCBD7C9160]
|
||||
|
||||
refUUID:E2A26BE4-534B-4B50-AA6F-D28A7BF13F54
|
||||
(filename):FL/Fl_PSfile_Device.H
|
||||
xcCopyHeaderID:13B77D5A401B98BD18D3CCF8
|
||||
|
||||
[./targets/libs/FCA55664-7065-436F-B7F2-7F7A397ED739/headers/405F4A61-8DD8-423C-938C-FA24D4E451AD]
|
||||
|
||||
refUUID:A59BDACF-075D-4E17-8BE8-38E0E7A51003
|
||||
@ -1702,6 +1697,7 @@ xcCopyHeaderID:72843BB6450DBFB9A9F53490
|
||||
|
||||
refUUID:D7271ED9-045A-4F82-A493-3717A1B0D3AE
|
||||
(filename):FL/Fl_Paged_Device.H
|
||||
xcCopyHeaderID:7582831EE62557F2D4668FA4
|
||||
|
||||
[./targets/libs/FCA55664-7065-436F-B7F2-7F7A397ED739/externals]
|
||||
|
||||
@ -7629,12 +7625,6 @@ xcBuildConfigurationReleaseID:9E23AA974E99E89DC5E46D9F
|
||||
[./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/sources]
|
||||
|
||||
|
||||
[./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/sources/2AA033DE-7570-445E-B0B8-B2695B27BC68]
|
||||
|
||||
refUUID:5684BCF0-9061-4396-A4F5-1E8E633F716B
|
||||
(filename):test/tree.cxx
|
||||
xcBuildFileID:8B1319F9AB1424C1480A3133
|
||||
|
||||
[./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/deps]
|
||||
|
||||
|
||||
@ -7644,6 +7634,12 @@ refUUID:FCA55664-7065-436F-B7F2-7F7A397ED739
|
||||
xcProxyID:02A677752D704FC1308C2C01
|
||||
xcDependencyID:89EEA83A9CD9747F05B1E6AA
|
||||
|
||||
[./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/deps/14C691AE-415D-4273-98F0-43175A8B54E6]
|
||||
|
||||
refUUID:D70F995E-DA2E-46A4-9F93-90D4F6C7DE87
|
||||
xcProxyID:14AFCE90907C6F3225151910
|
||||
xcDependencyID:9519279882836E4B8EDEBE60
|
||||
|
||||
[./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/libs]
|
||||
|
||||
|
||||
@ -7659,6 +7655,12 @@ xcCopyFrameworkID:F1C6FA1ABFEFA9DD53A7B8E8
|
||||
[./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/fl]
|
||||
|
||||
|
||||
[./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/fl/93140A57-AA6D-46BC-972D-8ADAED12A7A8]
|
||||
|
||||
refUUID:9ABC95B6-DEE6-4145-8EBA-A4D2CF1DC7CF
|
||||
(filename):test/tree.fl
|
||||
xcBuildFileID:16FC08C22B1B693EB00C15F5
|
||||
|
||||
[./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/externals]
|
||||
|
||||
|
||||
@ -8815,11 +8817,6 @@ xcFileID:D585CB55BDA143D343033352
|
||||
pathAndName:FL/Fl_Overlay_Window.H
|
||||
xcFileID:1FCDDD4E00F7CAA8193CAE04
|
||||
|
||||
[./files/E2A26BE4-534B-4B50-AA6F-D28A7BF13F54]
|
||||
|
||||
pathAndName:FL/Fl_PSfile_Device.H
|
||||
xcFileID:44C10E7FA85430F4E1D68B60
|
||||
|
||||
[./files/A59BDACF-075D-4E17-8BE8-38E0E7A51003]
|
||||
|
||||
pathAndName:FL/Fl_Pack.H
|
||||
@ -10290,11 +10287,6 @@ xcFileID:0DFF833B9E81E11FA3E3A85A
|
||||
pathAndName:test/tiled_image.cxx
|
||||
xcFileID:94D15578CD49CC75FE6617E4
|
||||
|
||||
[./files/5684BCF0-9061-4396-A4F5-1E8E633F716B]
|
||||
|
||||
pathAndName:test/tree.cxx
|
||||
xcFileID:ECCD42A2E7B2C6BF5B3DF410
|
||||
|
||||
[./files/7FB34E60-5136-423E-AD80-56CF9ABABE15]
|
||||
|
||||
pathAndName:test/utf8.cxx
|
||||
@ -10313,10 +10305,17 @@ xcFileID:48A8DC166D69EDC6F24AE678
|
||||
[./files/81A99CD2-985D-4B34-A385-DA2DF36B25C7]
|
||||
|
||||
pathAndName:src/Fl_Paged_Device.cxx
|
||||
xcFileID:6C1C9A4F054C48CDD6A2DE44
|
||||
|
||||
[./files/D7271ED9-045A-4F82-A493-3717A1B0D3AE]
|
||||
|
||||
pathAndName:FL/Fl_Paged_Device.H
|
||||
xcFileID:4CABCBB89F9DD5CF57BB9779
|
||||
|
||||
[./files/9ABC95B6-DEE6-4145-8EBA-A4D2CF1DC7CF]
|
||||
|
||||
pathAndName:test/tree.fl
|
||||
xcFileID:D10B1EA053B5C8F02A636D93
|
||||
|
||||
[./ide]
|
||||
|
||||
|
||||
@ -571,7 +571,6 @@ int create_new_database(const char *filename)
|
||||
fltk_lib.add_header(files_db, "FL/Fl_Object.H");
|
||||
fltk_lib.add_header(files_db, "FL/Fl_Output.H");
|
||||
fltk_lib.add_header(files_db, "FL/Fl_Overlay_Window.H");
|
||||
fltk_lib.add_header(files_db, "FL/Fl_PSfile_Device.H");
|
||||
fltk_lib.add_header(files_db, "FL/Fl_Pack.H");
|
||||
fltk_lib.add_header(files_db, "FL/Fl_Paged_Device.H");
|
||||
fltk_lib.add_header(files_db, "FL/Fl_Pixmap.H");
|
||||
@ -1324,8 +1323,9 @@ int create_new_database(const char *filename)
|
||||
}
|
||||
|
||||
{ Fl_Target_Prefs db(tests_db.add_with_key("name", "tree"));
|
||||
db.add_source(files_db, "test/tree.cxx");
|
||||
db.add_fl(files_db, "test/tree.fl");
|
||||
db.add_lib(fltk_lib);
|
||||
db.depends_on(fluid_app);
|
||||
demo_db.depends_on(db);
|
||||
}
|
||||
|
||||
|
||||
@ -1586,6 +1586,9 @@ Package=<4>
|
||||
Begin Project Dependency
|
||||
Project_Dep_Name fltk
|
||||
End Project Dependency
|
||||
Begin Project Dependency
|
||||
Project_Dep_Name Fluid
|
||||
End Project Dependency
|
||||
}}}
|
||||
|
||||
###############################################################################
|
||||
|
||||
@ -92,6 +92,37 @@ LINK32=link.exe
|
||||
# Begin Source File
|
||||
|
||||
SOURCE=..\..\test\tree.cxx
|
||||
# End Source File
|
||||
# Begin Source File
|
||||
|
||||
SOURCE=..\..\test\tree.fl
|
||||
|
||||
!IF "$(CFG)" == "tree - Win32 Release"
|
||||
|
||||
# Begin Custom Build - Create .cxx and .h file with fluid
|
||||
InputPath=..\..\test\tree.fl
|
||||
|
||||
"..\..\test\tree.cxx" : $(SOURCE) "$(INTDIR)" "$(OUTDIR)"
|
||||
cd ..\..\test/
|
||||
..\fluid\fluid -c tree.fl
|
||||
cd ..\ide\visualc
|
||||
|
||||
# End Custom Build
|
||||
|
||||
!ELSEIF "$(CFG)" == "tree - Win32 Debug"
|
||||
|
||||
# Begin Custom Build - Create .cxx and .h file with fluidd
|
||||
InputPath=..\..\test\tree.fl
|
||||
|
||||
"..\..\test\tree.cxx" : $(SOURCE) "$(INTDIR)" "$(OUTDIR)"
|
||||
cd ..\..\test/
|
||||
..\fluid\fluidd -c tree.fl
|
||||
cd ..\ide\visualc
|
||||
|
||||
# End Custom Build
|
||||
|
||||
!ENDIF
|
||||
|
||||
# End Source File
|
||||
# End Target
|
||||
# End Project
|
||||
|
||||
@ -60,7 +60,6 @@
|
||||
12E4293A141DD684369D6B8F /* fl_boxtype.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 9B54C6B8D801E899981FC5E6 /* fl_boxtype.cxx */; };
|
||||
12EDA8498FE1A47E32A9428E /* png.c in Sources */ = {isa = PBXBuildFile; fileRef = 5575DA9A654EB53C515F917A /* png.c */; };
|
||||
1328D9EE314856BAB7A54D5A /* Fl_BMP_Image.H in Headers */ = {isa = PBXBuildFile; fileRef = B20D11CF3F871C99011F632E /* Fl_BMP_Image.H */; settings = {ATTRIBUTES = (Public, ); }; };
|
||||
13B77D5A401B98BD18D3CCF8 /* Fl_PSfile_Device.H in Headers */ = {isa = PBXBuildFile; fileRef = 44C10E7FA85430F4E1D68B60 /* Fl_PSfile_Device.H */; settings = {ATTRIBUTES = (Public, ); }; };
|
||||
13DE96EAB36238A478381098 /* fltk.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = FEB0F8FE6383384180570D94 /* fltk.framework */; };
|
||||
1490AC534F76E26EF9280C6D /* Fl_add_idle.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 274CBEBF1D1BFD5C91605CBE /* Fl_add_idle.cxx */; };
|
||||
1565219A0166F42F299C2C9E /* Fl_Browser_load.cxx in Sources */ = {isa = PBXBuildFile; fileRef = E46A3C4F955A94AE095FF726 /* Fl_Browser_load.cxx */; };
|
||||
@ -68,6 +67,7 @@
|
||||
16C76FAEEC543074798FF0CB /* fltk.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = FEB0F8FE6383384180570D94 /* fltk.framework */; };
|
||||
16CA21C97F278A00B2558C3C /* pngread.c in Sources */ = {isa = PBXBuildFile; fileRef = C4CF7DDC2EC8792157A3F43B /* pngread.c */; };
|
||||
16F26F7D137CC7F7B57ECAC0 /* fltk_zlib.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = F8880CD3FEF32388A24C1B94 /* fltk_zlib.framework */; };
|
||||
16FC08C22B1B693EB00C15F5 /* tree.fl in Sources */ = {isa = PBXBuildFile; fileRef = D10B1EA053B5C8F02A636D93 /* tree.fl */; };
|
||||
17875FB347705D46D333E6EC /* fractals.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 598DD70F89D7731D61BBD8EF /* fractals.cxx */; };
|
||||
180F08AFCDEE94081FDCD9AF /* Fl_Choice.H in Headers */ = {isa = PBXBuildFile; fileRef = C8AE10A8DDF53B8B27E3215A /* Fl_Choice.H */; settings = {ATTRIBUTES = (Public, ); }; };
|
||||
185933E619D6C024C4B53D3B /* Fl_Value_Input.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 34CB383C3A4360C14B58562E /* Fl_Value_Input.cxx */; };
|
||||
@ -129,9 +129,9 @@
|
||||
2800B0509A5D20FABE8F02DC /* fl_show_colormap.cxx in Sources */ = {isa = PBXBuildFile; fileRef = EB15CE98189A4C0A7A8A480F /* fl_show_colormap.cxx */; };
|
||||
2832E97111DB41A4B13A4EFE /* keyboard_ui.fl in Sources */ = {isa = PBXBuildFile; fileRef = 7B084447C58E292798B27283 /* keyboard_ui.fl */; };
|
||||
285B384349B0FC5FCE9C9FCE /* fl_open_uri.cxx in Sources */ = {isa = PBXBuildFile; fileRef = FAD24127A06F3F9F0EEB843A /* fl_open_uri.cxx */; };
|
||||
28A5D2BB72720891608E7B82 /* Fl_Abstract_Printer.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 5E009E15C14AA1D60827722D /* Fl_Abstract_Printer.cxx */; };
|
||||
291FA24A9E91A2036BC718A2 /* Fl_Overlay_Window.cxx in Sources */ = {isa = PBXBuildFile; fileRef = D1C792936D427CC48581BFAE /* Fl_Overlay_Window.cxx */; };
|
||||
29303C4480E0BBEB9E29EE7B /* vsnprintf.c in Sources */ = {isa = PBXBuildFile; fileRef = EBC0D2C965EDD6503B0CF519 /* vsnprintf.c */; };
|
||||
299CB8A2848CB844BCEC7829 /* Fl_Paged_Device.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 6C1C9A4F054C48CDD6A2DE44 /* Fl_Paged_Device.cxx */; };
|
||||
29A99477531233BE9391CE66 /* Fl_Slider.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 5AF5119D08DFC92EA1032671 /* Fl_Slider.cxx */; };
|
||||
29B01C1F3FF6C5B007DEEF45 /* fltk.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = FEB0F8FE6383384180570D94 /* fltk.framework */; };
|
||||
29ED282EF51CBBB0CDEE76D6 /* Fl_Color_Chooser.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 058BCBC36ADE724A418F1C43 /* Fl_Color_Chooser.cxx */; };
|
||||
@ -368,6 +368,7 @@
|
||||
74D195DEE3A33FA0C8C7A5BE /* Fl_Help_View.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 790419B5A0AD64D66F9B19E1 /* Fl_Help_View.cxx */; };
|
||||
74D5FD7ED2AF3F51D8B2EEEB /* Fl_Slider.H in Headers */ = {isa = PBXBuildFile; fileRef = F2E5612A81A6E8D53ED91CAE /* Fl_Slider.H */; settings = {ATTRIBUTES = (Public, ); }; };
|
||||
753A6417598E2D35C308632A /* valuators.fl in Sources */ = {isa = PBXBuildFile; fileRef = 590C56F672356072A5C86BC3 /* valuators.fl */; };
|
||||
7582831EE62557F2D4668FA4 /* Fl_Paged_Device.H in Headers */ = {isa = PBXBuildFile; fileRef = 4CABCBB89F9DD5CF57BB9779 /* Fl_Paged_Device.H */; settings = {ATTRIBUTES = (Public, ); }; };
|
||||
761829645FD3BCA7EE9DE369 /* fltk_gl.framework in CopyFiles */ = {isa = PBXBuildFile; fileRef = EA8E6EC230301E597B9D9AED /* fltk_gl.framework */; };
|
||||
762325B25679668EB687A028 /* gl_overlay.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 1F6E4CE3C0DF58D8F7B3A94A /* gl_overlay.cxx */; };
|
||||
76BA5F2997A55DDFA04EFC98 /* ide_visualc.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 9C0598A21FEE02AA4F0E39C9 /* ide_visualc.cxx */; };
|
||||
@ -430,7 +431,6 @@
|
||||
8A80E9D910324212101C3E76 /* fltk.framework in CopyFiles */ = {isa = PBXBuildFile; fileRef = FEB0F8FE6383384180570D94 /* fltk.framework */; };
|
||||
8AB3C564389AED897174FFF2 /* Fl_Type.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 0B800D01D215C41573FFE4DA /* Fl_Type.cxx */; };
|
||||
8AC8FF5C9534F6E0664A352B /* fltk.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = FEB0F8FE6383384180570D94 /* fltk.framework */; };
|
||||
8B1319F9AB1424C1480A3133 /* tree.cxx in Sources */ = {isa = PBXBuildFile; fileRef = ECCD42A2E7B2C6BF5B3DF410 /* tree.cxx */; };
|
||||
8BA3F05B96804E0FD9491049 /* fltk.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = FEB0F8FE6383384180570D94 /* fltk.framework */; };
|
||||
8CC2898FB12015F247784420 /* jdcoefct.c in Sources */ = {isa = PBXBuildFile; fileRef = A715D265EAD3C5DA5628485C /* jdcoefct.c */; };
|
||||
8CCF18F146F2012A0C1DC330 /* Fl_Return_Button.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 9A3D4184FF1C89B7CEE9FBD6 /* Fl_Return_Button.cxx */; };
|
||||
@ -568,7 +568,6 @@
|
||||
BCFD2D2C8ED191EFB52166A4 /* fl_show_input.H in Headers */ = {isa = PBXBuildFile; fileRef = EFAE92A1C7CA90BC56E5A70A /* fl_show_input.H */; settings = {ATTRIBUTES = (Public, ); }; };
|
||||
BD48B8B0B3DE04E72A17F60D /* jdmarker.c in Sources */ = {isa = PBXBuildFile; fileRef = BB37899B104B362F32F0F417 /* jdmarker.c */; };
|
||||
BDB3A4C9B2AC519DC6A95D84 /* fl_dnd.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 2DD93178E8AFA850DAC293FC /* fl_dnd.cxx */; };
|
||||
BE079BCB8B1142B84067555A /* Fl_Abstract_Printer.H in Headers */ = {isa = PBXBuildFile; fileRef = F9AAAD5964050A3DC9E20879 /* Fl_Abstract_Printer.H */; settings = {ATTRIBUTES = (Public, ); }; };
|
||||
BF212FE1FA8676E379DE4BC1 /* fltk_gl.framework in CopyFiles */ = {isa = PBXBuildFile; fileRef = EA8E6EC230301E597B9D9AED /* fltk_gl.framework */; };
|
||||
BF3BDB0B4DA065027B4771CA /* fltk.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = FEB0F8FE6383384180570D94 /* fltk.framework */; };
|
||||
BF7219C14C522420ED920D72 /* Fl_Simple_Counter.H in Headers */ = {isa = PBXBuildFile; fileRef = 9B57B581401BD8575BFAF2F1 /* Fl_Simple_Counter.H */; settings = {ATTRIBUTES = (Public, ); }; };
|
||||
@ -1785,6 +1784,13 @@
|
||||
remoteGlobalIDString = A57FDE871C99A52BEEDEE68C;
|
||||
remoteInfo = fltk;
|
||||
};
|
||||
14AFCE90907C6F3225151910 /* PBXContainerItemProxy */ = {
|
||||
isa = PBXContainerItemProxy;
|
||||
containerPortal = 4BF1A7FFEACF5F31B4127482 /* Project object */;
|
||||
proxyType = 1;
|
||||
remoteGlobalIDString = AE6BC0AEB24EBBBDBA4071E0;
|
||||
remoteInfo = Fluid;
|
||||
};
|
||||
16BBABAD50B4194D5D76302F /* PBXContainerItemProxy */ = {
|
||||
isa = PBXContainerItemProxy;
|
||||
containerPortal = 4BF1A7FFEACF5F31B4127482 /* Project object */;
|
||||
@ -3947,7 +3953,6 @@
|
||||
43D9A7CD936B1382F5EA23E1 /* about_panel.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = about_panel.cxx; path = ../../fluid/about_panel.cxx; sourceTree = SOURCE_ROOT; };
|
||||
44277061B27BFBE1FB22B79B /* menubar.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = menubar.cxx; path = ../../test/menubar.cxx; sourceTree = SOURCE_ROOT; };
|
||||
44B6E71105CCEECB4D5E2DC8 /* ide_support.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = ide_support.h; path = ../../fluid/ide_support.h; sourceTree = SOURCE_ROOT; };
|
||||
44C10E7FA85430F4E1D68B60 /* Fl_PSfile_Device.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_PSfile_Device.H; path = ../../FL/Fl_PSfile_Device.H; sourceTree = SOURCE_ROOT; };
|
||||
451D01896EFDD83277515630 /* glut.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = glut.H; path = ../../FL/glut.H; sourceTree = SOURCE_ROOT; };
|
||||
4577F046D6D5D93D2553BFBC /* jdtrans.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = jdtrans.c; path = ../../jpeg/jdtrans.c; sourceTree = SOURCE_ROOT; };
|
||||
45B993D3FA0EED6037499D3A /* color_chooser.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = color_chooser.cxx; path = ../../test/color_chooser.cxx; sourceTree = SOURCE_ROOT; };
|
||||
@ -3965,6 +3970,7 @@
|
||||
4C2979BC9629FABDCC0271BB /* jcmainct.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = jcmainct.c; path = ../../jpeg/jcmainct.c; sourceTree = SOURCE_ROOT; };
|
||||
4C2EEE3E17025A63A0AEEF5F /* hello.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = hello.cxx; path = ../../test/hello.cxx; sourceTree = SOURCE_ROOT; };
|
||||
4C9AF6F2C1B78A67FFD177F9 /* gl2opengl.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = gl2opengl.h; path = ../../FL/gl2opengl.h; sourceTree = SOURCE_ROOT; };
|
||||
4CABCBB89F9DD5CF57BB9779 /* Fl_Paged_Device.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Paged_Device.H; path = ../../FL/Fl_Paged_Device.H; sourceTree = SOURCE_ROOT; };
|
||||
4CD4094D8712818EACF5C7C5 /* Fl_Progress.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Progress.H; path = ../../FL/Fl_Progress.H; sourceTree = SOURCE_ROOT; };
|
||||
4CD5A5D2975A2CCB77EBAD43 /* jutils.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = jutils.c; path = ../../jpeg/jutils.c; sourceTree = SOURCE_ROOT; };
|
||||
4D124BD72F4E63D99837CE0C /* fl_encoding_latin1.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = fl_encoding_latin1.cxx; path = ../../src/fl_encoding_latin1.cxx; sourceTree = SOURCE_ROOT; };
|
||||
@ -4005,7 +4011,6 @@
|
||||
5CDA214AEABC15E3EF1BB172 /* Fl_Adjuster.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Adjuster.H; path = ../../FL/Fl_Adjuster.H; sourceTree = SOURCE_ROOT; };
|
||||
5CE4CB9AEF9070A32A27696D /* fl_overlay_visual.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = fl_overlay_visual.cxx; path = ../../src/fl_overlay_visual.cxx; sourceTree = SOURCE_ROOT; };
|
||||
5D36F806A2C72F1894F0878E /* Fl_File_Icon.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_File_Icon.cxx; path = ../../src/Fl_File_Icon.cxx; sourceTree = SOURCE_ROOT; };
|
||||
5E009E15C14AA1D60827722D /* Fl_Abstract_Printer.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_Abstract_Printer.cxx; path = ../../src/Fl_Abstract_Printer.cxx; sourceTree = SOURCE_ROOT; };
|
||||
5E0EC227A972D2E4F34A2CEB /* Fl_Tree.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Tree.H; path = ../../FL/Fl_Tree.H; sourceTree = SOURCE_ROOT; };
|
||||
5EF025FDE53B2276B6931CD5 /* clock.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = clock.cxx; path = ../../test/clock.cxx; sourceTree = SOURCE_ROOT; };
|
||||
5F328DFEE7B768CF141C8E9E /* zutil.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = zutil.c; path = ../../zlib/zutil.c; sourceTree = SOURCE_ROOT; };
|
||||
@ -4033,6 +4038,7 @@
|
||||
6B30F6EA5CA69E305D2B82EE /* is_right2left.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = is_right2left.c; path = ../../src/xutf8/is_right2left.c; sourceTree = SOURCE_ROOT; };
|
||||
6BCDA929CD8600DE9AC516DD /* compress.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = compress.c; path = ../../zlib/compress.c; sourceTree = SOURCE_ROOT; };
|
||||
6BDBE905BDAC3374782D6E81 /* input.app */ = {isa = PBXFileReference; explicitFileType = wrapper.application; includeInIndex = 0; path = input.app; sourceTree = BUILT_PRODUCTS_DIR; };
|
||||
6C1C9A4F054C48CDD6A2DE44 /* Fl_Paged_Device.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_Paged_Device.cxx; path = ../../src/Fl_Paged_Device.cxx; sourceTree = SOURCE_ROOT; };
|
||||
6C64353A3129BCCFAA667D86 /* boxtype.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = boxtype.cxx; path = ../../test/boxtype.cxx; sourceTree = SOURCE_ROOT; };
|
||||
6CCA5064754A8314839CB37A /* freeglut_stroke_roman.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = freeglut_stroke_roman.cxx; path = ../../src/freeglut_stroke_roman.cxx; sourceTree = SOURCE_ROOT; };
|
||||
6D999C03407EAEE9C4D3477A /* browser.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = browser.cxx; path = ../../test/browser.cxx; sourceTree = SOURCE_ROOT; };
|
||||
@ -4257,6 +4263,7 @@
|
||||
D02CF2893ECCE831CD5D3176 /* Fl_Multi_Label.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_Multi_Label.cxx; path = ../../src/Fl_Multi_Label.cxx; sourceTree = SOURCE_ROOT; };
|
||||
D06E371A971A3BC1B399AD78 /* button.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = button.cxx; path = ../../test/button.cxx; sourceTree = SOURCE_ROOT; };
|
||||
D0E376E93B4F22BE701D29E0 /* Fl_Roller.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_Roller.cxx; path = ../../src/Fl_Roller.cxx; sourceTree = SOURCE_ROOT; };
|
||||
D10B1EA053B5C8F02A636D93 /* tree.fl */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.fluid; name = tree.fl; path = ../../test/tree.fl; sourceTree = SOURCE_ROOT; };
|
||||
D1C792936D427CC48581BFAE /* Fl_Overlay_Window.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_Overlay_Window.cxx; path = ../../src/Fl_Overlay_Window.cxx; sourceTree = SOURCE_ROOT; };
|
||||
D2DE1079C826533A91053A9C /* Fl_XBM_Image.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_XBM_Image.H; path = ../../FL/Fl_XBM_Image.H; sourceTree = SOURCE_ROOT; };
|
||||
D33C668435685F7CCB359EE2 /* pngrio.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = pngrio.c; path = ../../png/pngrio.c; sourceTree = SOURCE_ROOT; };
|
||||
@ -4336,7 +4343,6 @@
|
||||
EC2BAEE540612218DC9EEC75 /* Fl_Scroll.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Scroll.H; path = ../../FL/Fl_Scroll.H; sourceTree = SOURCE_ROOT; };
|
||||
EC57889382FB898FD3EF2580 /* Fl_Gl_Window.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_Gl_Window.cxx; path = ../../src/Fl_Gl_Window.cxx; sourceTree = SOURCE_ROOT; };
|
||||
EC5862E1FC79542DC55D8462 /* colbrowser.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = colbrowser.cxx; path = ../../test/colbrowser.cxx; sourceTree = SOURCE_ROOT; };
|
||||
ECCD42A2E7B2C6BF5B3DF410 /* tree.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = tree.cxx; path = ../../test/tree.cxx; sourceTree = SOURCE_ROOT; };
|
||||
ECFF712363202EC351A51E53 /* Fl_PNM_Image.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_PNM_Image.cxx; path = ../../src/Fl_PNM_Image.cxx; sourceTree = SOURCE_ROOT; };
|
||||
EDCB878D48197F6AE1C99614 /* jidctred.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = jidctred.c; path = ../../jpeg/jidctred.c; sourceTree = SOURCE_ROOT; };
|
||||
EDE6CE6B09D31AC0AAC9FF56 /* fullscreen.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = fullscreen.cxx; path = ../../test/fullscreen.cxx; sourceTree = SOURCE_ROOT; };
|
||||
@ -4366,7 +4372,6 @@
|
||||
F8BAA8B283D4CF4D904B6486 /* Fl_Valuator.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Valuator.H; path = ../../FL/Fl_Valuator.H; sourceTree = SOURCE_ROOT; };
|
||||
F91DEF40DC3592BE52CAB001 /* Fl_Native_File_Chooser.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Native_File_Chooser.H; path = ../../FL/Fl_Native_File_Chooser.H; sourceTree = SOURCE_ROOT; };
|
||||
F98FE04C081FB5B1161C546C /* Fl_Window.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Window.H; path = ../../FL/Fl_Window.H; sourceTree = SOURCE_ROOT; };
|
||||
F9AAAD5964050A3DC9E20879 /* Fl_Abstract_Printer.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Abstract_Printer.H; path = ../../FL/Fl_Abstract_Printer.H; sourceTree = SOURCE_ROOT; };
|
||||
FA2F70BA8FF4E7F4B7B36971 /* fl_file_dir.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = fl_file_dir.cxx; path = ../../src/fl_file_dir.cxx; sourceTree = SOURCE_ROOT; };
|
||||
FAA6BA6E4DC1AF28F5FC8466 /* Fl_Tile.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Tile.H; path = ../../FL/Fl_Tile.H; sourceTree = SOURCE_ROOT; };
|
||||
FAD24127A06F3F9F0EEB843A /* fl_open_uri.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = fl_open_uri.cxx; path = ../../src/fl_open_uri.cxx; sourceTree = SOURCE_ROOT; };
|
||||
@ -5154,7 +5159,6 @@
|
||||
children = (
|
||||
B04F6E032ADAF0A16A860A2E /* Headers */,
|
||||
F4EFF27D730BED51EF0EAA8D /* Fl.cxx */,
|
||||
5E009E15C14AA1D60827722D /* Fl_Abstract_Printer.cxx */,
|
||||
19C5DB6F3DD5011DAE6F79AB /* Fl_Adjuster.cxx */,
|
||||
3F000DD5F091F66BC42822E3 /* Fl_Bitmap.cxx */,
|
||||
C3F048573FAEABD2D27401D4 /* Fl_Box.cxx */,
|
||||
@ -5303,6 +5307,7 @@
|
||||
FB7A9EFB3C7CDAE324E9544F /* case.c */,
|
||||
6B30F6EA5CA69E305D2B82EE /* is_right2left.c */,
|
||||
5AE1F936F1C186E18C1B9C28 /* is_spacing.c */,
|
||||
6C1C9A4F054C48CDD6A2DE44 /* Fl_Paged_Device.cxx */,
|
||||
E05754DEC1813B6BA6DC1FC8 /* AudioToolbox.framework */,
|
||||
);
|
||||
name = fltk;
|
||||
@ -5420,7 +5425,7 @@
|
||||
2DD062AF5E08E6EEAE97E188 /* tree */ = {
|
||||
isa = PBXGroup;
|
||||
children = (
|
||||
ECCD42A2E7B2C6BF5B3DF410 /* tree.cxx */,
|
||||
D10B1EA053B5C8F02A636D93 /* tree.fl */,
|
||||
);
|
||||
name = tree;
|
||||
sourceTree = "<group>";
|
||||
@ -5904,7 +5909,6 @@
|
||||
children = (
|
||||
84CE79448708855561FEE498 /* Enumerations.H */,
|
||||
C359E5D5187606DD69C7938B /* Fl.H */,
|
||||
F9AAAD5964050A3DC9E20879 /* Fl_Abstract_Printer.H */,
|
||||
5CDA214AEABC15E3EF1BB172 /* Fl_Adjuster.H */,
|
||||
FE90AA3BB40510FA45E0C27B /* Fl_Bitmap.H */,
|
||||
390863A4D5D1B4C7C9B58679 /* Fl_Box.H */,
|
||||
@ -5962,7 +5966,6 @@
|
||||
EE2FB1F7B99BE408E1B4DFB7 /* Fl_Object.H */,
|
||||
D585CB55BDA143D343033352 /* Fl_Output.H */,
|
||||
1FCDDD4E00F7CAA8193CAE04 /* Fl_Overlay_Window.H */,
|
||||
44C10E7FA85430F4E1D68B60 /* Fl_PSfile_Device.H */,
|
||||
52C3B1D0A473BDC01D497917 /* Fl_Pack.H */,
|
||||
B8455C1BD96FF6FB3C197C34 /* Fl_Pixmap.H */,
|
||||
A8F89055CABBCFECCC4CC940 /* Fl_Plugin.H */,
|
||||
@ -6030,6 +6033,7 @@
|
||||
D5CE28437ABB8513BE08AC77 /* names.h */,
|
||||
62281FC096BA407C4F1E6824 /* win32.H */,
|
||||
83CED42A779FA76E98D37CA8 /* x.H */,
|
||||
4CABCBB89F9DD5CF57BB9779 /* Fl_Paged_Device.H */,
|
||||
);
|
||||
name = Headers;
|
||||
sourceTree = "<group>";
|
||||
@ -6422,7 +6426,6 @@
|
||||
files = (
|
||||
05D71028D71BB089B3157E35 /* Enumerations.H in Headers */,
|
||||
0231212CBF1A26721E3F20FE /* Fl.H in Headers */,
|
||||
BE079BCB8B1142B84067555A /* Fl_Abstract_Printer.H in Headers */,
|
||||
1EE443C865A80CACB57E4815 /* Fl_Adjuster.H in Headers */,
|
||||
424ADD12193823093AF1FBDF /* Fl_Bitmap.H in Headers */,
|
||||
E02DABD44EE5FDAC20F3F676 /* Fl_Box.H in Headers */,
|
||||
@ -6480,7 +6483,6 @@
|
||||
A9E5239AB84083A21F3F490B /* Fl_Object.H in Headers */,
|
||||
62CFB49620B17B8938A1063F /* Fl_Output.H in Headers */,
|
||||
012DC7566408D3CBF672BE50 /* Fl_Overlay_Window.H in Headers */,
|
||||
13B77D5A401B98BD18D3CCF8 /* Fl_PSfile_Device.H in Headers */,
|
||||
3D282039331A6ECDFED5255E /* Fl_Pack.H in Headers */,
|
||||
B9134F6A1769B94761981AEA /* Fl_Pixmap.H in Headers */,
|
||||
93CC0E443DAAB241C7EEE4B7 /* Fl_Plugin.H in Headers */,
|
||||
@ -6548,6 +6550,7 @@
|
||||
D8C2D8F3053EEF229EEF66FB /* names.h in Headers */,
|
||||
43EF9194502AFF8F5EE968EE /* win32.H in Headers */,
|
||||
72843BB6450DBFB9A9F53490 /* x.H in Headers */,
|
||||
7582831EE62557F2D4668FA4 /* Fl_Paged_Device.H in Headers */,
|
||||
);
|
||||
runOnlyForDeploymentPostprocessing = 0;
|
||||
};
|
||||
@ -8208,6 +8211,7 @@
|
||||
);
|
||||
dependencies = (
|
||||
89EEA83A9CD9747F05B1E6AA /* PBXTargetDependency */,
|
||||
9519279882836E4B8EDEBE60 /* PBXTargetDependency */,
|
||||
);
|
||||
name = tree;
|
||||
productName = tree;
|
||||
@ -8991,7 +8995,7 @@
|
||||
isa = PBXSourcesBuildPhase;
|
||||
buildActionMask = 2147483647;
|
||||
files = (
|
||||
8B1319F9AB1424C1480A3133 /* tree.cxx in Sources */,
|
||||
16FC08C22B1B693EB00C15F5 /* tree.fl in Sources */,
|
||||
);
|
||||
runOnlyForDeploymentPostprocessing = 0;
|
||||
};
|
||||
@ -9094,7 +9098,6 @@
|
||||
buildActionMask = 2147483647;
|
||||
files = (
|
||||
ED83B85BA678C8C9B5E91535 /* Fl.cxx in Sources */,
|
||||
28A5D2BB72720891608E7B82 /* Fl_Abstract_Printer.cxx in Sources */,
|
||||
B371C5FF1106E69056784D6C /* Fl_Adjuster.cxx in Sources */,
|
||||
274F92CF30A586E0F8E21530 /* Fl_Bitmap.cxx in Sources */,
|
||||
40E66CBA06083998669F80CE /* Fl_Box.cxx in Sources */,
|
||||
@ -9243,6 +9246,7 @@
|
||||
EF0B77D0D7EF375C1CBDC390 /* case.c in Sources */,
|
||||
CE14EC6653D4EF4779992758 /* is_right2left.c in Sources */,
|
||||
9DD7A2B6D63D30C07781F446 /* is_spacing.c in Sources */,
|
||||
299CB8A2848CB844BCEC7829 /* Fl_Paged_Device.cxx in Sources */,
|
||||
);
|
||||
runOnlyForDeploymentPostprocessing = 0;
|
||||
};
|
||||
@ -10253,6 +10257,11 @@
|
||||
target = 5C2FE9F5E71E04EA903248FA /* input */;
|
||||
targetProxy = 3B38ABA4483E58B2891D08CB /* PBXContainerItemProxy */;
|
||||
};
|
||||
9519279882836E4B8EDEBE60 /* PBXTargetDependency */ = {
|
||||
isa = PBXTargetDependency;
|
||||
target = AE6BC0AEB24EBBBDBA4071E0 /* Fluid */;
|
||||
targetProxy = 14AFCE90907C6F3225151910 /* PBXContainerItemProxy */;
|
||||
};
|
||||
951CA1D37E7F30B53E37B095 /* PBXTargetDependency */ = {
|
||||
isa = PBXTargetDependency;
|
||||
target = A57FDE871C99A52BEEDEE68C /* fltk */;
|
||||
|
||||
@ -1031,6 +1031,8 @@ Fl_File_Chooser::filter(const char *p) // I - Pattern(s)
|
||||
if (!allfiles) showChoice->add(all_files_label);
|
||||
|
||||
showChoice->add(custom_filter_label);
|
||||
|
||||
// TODO: add a menu item to switch hidden files on and off
|
||||
|
||||
showChoice->value(0);
|
||||
showChoiceCB();
|
||||
|
||||
@ -722,12 +722,12 @@ static void undobuffersize(int n) {
|
||||
<tt>when() & FL_WHEN_CHANGED</tt> and there is a change.
|
||||
|
||||
Set \p b and \p e equal to not delete anything.
|
||||
Set insert to \c NULL to not insert anything.
|
||||
Set \p text to \c NULL to not insert anything.
|
||||
|
||||
\p ilen must be zero or strlen(insert), this
|
||||
\p ilen can be zero or <tt>strlen(text)</tt>, which
|
||||
saves a tiny bit of time if you happen to already know the
|
||||
length of the insertion, or can be used to insert a portion of a
|
||||
string or a string containing <tt>nul</tt>'s.
|
||||
string.
|
||||
|
||||
\p b and \p e are clamped to the
|
||||
<tt>0..size()</tt> range, so it is safe to pass any values.
|
||||
|
||||
@ -379,17 +379,6 @@ Fl_Preferences::~Fl_Preferences()
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
Copy the database hierarchy to an Fl_Tree browser from this node down.
|
||||
*/
|
||||
char Fl_Preferences::copyTo(Fl_Tree *tree)
|
||||
{
|
||||
if (!tree->root())
|
||||
tree->add(name());
|
||||
return node->copyTo(tree, tree->root());
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
Returns the number of groups that are contained within a group.
|
||||
|
||||
@ -1762,28 +1751,6 @@ void Fl_Preferences::Node::deleteIndex() {
|
||||
indexed_ = 0;
|
||||
}
|
||||
|
||||
char Fl_Preferences::Node::copyTo(Fl_Tree *tree, Fl_Tree_Item *ti)
|
||||
{
|
||||
ti->label(name());
|
||||
ti->user_data(this);
|
||||
Node *nd = child_;
|
||||
for ( ; nd; nd = nd->next_) {
|
||||
Fl_Tree_Item *tic = tree->insert(ti, 0, 0);
|
||||
nd->copyTo(tree, tic);
|
||||
tic->close();
|
||||
}
|
||||
int i, n = nEntry_;
|
||||
for (i=0; i<n; i++) {
|
||||
char buf[80];
|
||||
const char *name = entry_[i].name;
|
||||
const char *value = entry_[i].value;
|
||||
fl_snprintf(buf, 80, "%s: %s", name, value);
|
||||
tree->add(ti, buf);
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* \brief Create a plugin.
|
||||
*
|
||||
|
||||
@ -1909,7 +1909,7 @@ static void addPadding(char *string, int startIndent, int toIndent,
|
||||
|
||||
if (useTabs) {
|
||||
while (indent < toIndent) {
|
||||
static char t = '\t';
|
||||
//static char t = '\t';
|
||||
len = Fl_Text_Buffer::character_width("\t", indent, tabDist);
|
||||
if (len > 1 && indent + len <= toIndent) {
|
||||
*outPtr++ = '\t';
|
||||
|
||||
@ -7,6 +7,7 @@
|
||||
#include <string.h>
|
||||
|
||||
#include <FL/Fl_Tree.H>
|
||||
#include <FL/Fl_Preferences.H>
|
||||
|
||||
#define SCROLL_W 15
|
||||
|
||||
@ -426,6 +427,56 @@ int Fl_Tree::select_only(Fl_Tree_Item *selitem, int docallback) {
|
||||
return(changed);
|
||||
}
|
||||
|
||||
/**
|
||||
* Read a preferences database into the tree widget.
|
||||
* A preferences database is a hierarchical collection of data which can be
|
||||
* directly loaded into the tree view for inspection.
|
||||
* \param[in] prefs the Fl_Preferences database
|
||||
*/
|
||||
void Fl_Tree::load(Fl_Preferences &prefs)
|
||||
{
|
||||
int i, j, n, pn = strlen(prefs.path());
|
||||
char *p;
|
||||
const char *path = prefs.path();
|
||||
if (strcmp(path, ".")==0)
|
||||
path += 1; // root path is empty
|
||||
else
|
||||
path += 2; // child path starts with "./"
|
||||
n = prefs.groups();
|
||||
for (i=0; i<n; i++) {
|
||||
Fl_Preferences prefsChild(prefs, i);
|
||||
add(prefsChild.path()+2); // children always start with "./"
|
||||
load(prefsChild);
|
||||
}
|
||||
n = prefs.entries();
|
||||
for (i=0; i<n; i++) {
|
||||
// We must remove all fwd slashes in the key and value strings. Replace with backslash.
|
||||
char *key = strdup(prefs.entry(i));
|
||||
int kn = strlen(key);
|
||||
for (j=0; j<kn; j++) {
|
||||
if (key[j]=='/') key[j]='\\';
|
||||
}
|
||||
char *val; prefs.get(key, val, "");
|
||||
int vn = strlen(val);
|
||||
for (j=0; j<vn; j++) {
|
||||
if (val[j]=='/') val[j]='\\';
|
||||
}
|
||||
if (vn<40) {
|
||||
int sze = pn + strlen(key) + vn;
|
||||
p = (char*)malloc(sze+5);
|
||||
sprintf(p, "%s/%s = %s", path, key, val);
|
||||
} else {
|
||||
int sze = pn + strlen(key) + 40;
|
||||
p = (char*)malloc(sze+5);
|
||||
sprintf(p, "%s/%s = %.40s...", path, key, val);
|
||||
}
|
||||
add(p[0]=='/'?p+1:p);
|
||||
free(p);
|
||||
free(val);
|
||||
free(key);
|
||||
}
|
||||
}
|
||||
|
||||
//
|
||||
// End of "$Id$".
|
||||
//
|
||||
|
||||
@ -481,6 +481,11 @@ void Fl_Tree_Item::draw(int X, int &Y, int W, Fl_Widget *tree,
|
||||
int H = _labelsize;
|
||||
if(usericon() && H < usericon()->h()) H = usericon()->h();
|
||||
H += prefs.linespacing() + fl_descent();
|
||||
// adjust horizontally if we draw no connecting lines
|
||||
if ( is_root() && prefs.connectorstyle() == FL_TREE_CONNECTOR_NONE ) {
|
||||
X -= prefs.openicon()->w();
|
||||
W += prefs.openicon()->w();
|
||||
}
|
||||
// Colors, fonts
|
||||
Fl_Color fg = _selected ? prefs.bgcolor() : _labelfgcolor;
|
||||
Fl_Color bg = _selected ? prefs.selectcolor() : _labelbgcolor;
|
||||
@ -497,9 +502,9 @@ void Fl_Tree_Item::draw(int X, int &Y, int W, Fl_Widget *tree,
|
||||
int textw=0, texth=0;
|
||||
fl_measure(_label, textw, texth, 0);
|
||||
int textycenter = Y+(H/2);
|
||||
int &icon_x = _collapse_xywh[0] = X-1;
|
||||
int &icon_y = _collapse_xywh[1] = textycenter - (prefs.openicon()->h()/2);
|
||||
int &icon_w = _collapse_xywh[2] = prefs.openicon()->w();
|
||||
int &icon_x = _collapse_xywh[0] = X + (icon_w + prefs.connectorwidth())/2 - 3;
|
||||
int &icon_y = _collapse_xywh[1] = textycenter - (prefs.openicon()->h()/2);
|
||||
_collapse_xywh[3] = prefs.openicon()->h();
|
||||
// Horizontal connector values
|
||||
int hstartx = X+icon_w/2-1;
|
||||
@ -514,7 +519,11 @@ void Fl_Tree_Item::draw(int X, int &Y, int W, Fl_Widget *tree,
|
||||
// Draw connectors
|
||||
if ( prefs.connectorstyle() != FL_TREE_CONNECTOR_NONE ) {
|
||||
// Horiz connector between center of icon and text
|
||||
draw_horizontal_connector(hstartx, hendx, textycenter, prefs);
|
||||
// if this is root, the connector should not dangle in thin air on the left
|
||||
if (is_root())
|
||||
draw_horizontal_connector(hcenterx, hendx, textycenter, prefs);
|
||||
else
|
||||
draw_horizontal_connector(hstartx, hendx, textycenter, prefs);
|
||||
if ( has_children() && is_open() ) {
|
||||
// Small vertical line down to children
|
||||
draw_vertical_connector(hcenterx, textycenter, Y+H, prefs);
|
||||
@ -538,9 +547,11 @@ void Fl_Tree_Item::draw(int X, int &Y, int W, Fl_Widget *tree,
|
||||
}
|
||||
}
|
||||
// Background for this item
|
||||
int &bx = _label_xywh[0] = X+(icon_w/2-1+prefs.connectorwidth());
|
||||
int cw1 = icon_w+prefs.connectorwidth()/2, cw2 = prefs.connectorwidth();
|
||||
int cwidth = cw1>cw2 ? cw1 : cw2;
|
||||
int &bx = _label_xywh[0] = X+(icon_w/2-1+cwidth);
|
||||
int &by = _label_xywh[1] = Y;
|
||||
int &bw = _label_xywh[2] = W-(icon_w/2-1+prefs.connectorwidth());
|
||||
int &bw = _label_xywh[2] = W-(icon_w/2-1+cwidth);
|
||||
int &bh = _label_xywh[3] = H;
|
||||
// Draw bg only if different from tree's bg
|
||||
if ( bg != tree->color() || is_selected() ) {
|
||||
@ -554,7 +565,7 @@ void Fl_Tree_Item::draw(int X, int &Y, int W, Fl_Widget *tree,
|
||||
}
|
||||
}
|
||||
// Draw user icon (if any)
|
||||
int useroff = (icon_w/2-1+prefs.connectorwidth());
|
||||
int useroff = (icon_w/2-1+cwidth);
|
||||
if ( usericon() ) {
|
||||
// Item has user icon? Use it
|
||||
useroff += prefs.usericonmarginleft();
|
||||
|
||||
@ -34,6 +34,22 @@
|
||||
// These can be replaced via prefs.openicon()/closeicon()
|
||||
//
|
||||
static const char *L_open_xpm[] = {
|
||||
#ifdef __APPLE__
|
||||
"11 11 2 1",
|
||||
". c None",
|
||||
"@ c #000000",
|
||||
"...@.......",
|
||||
"...@@......",
|
||||
"...@@@.....",
|
||||
"...@@@@....",
|
||||
"...@@@@@...",
|
||||
"...@@@@@@..",
|
||||
"...@@@@@...",
|
||||
"...@@@@....",
|
||||
"...@@@.....",
|
||||
"...@@......",
|
||||
"...@......."
|
||||
#else
|
||||
"11 11 3 1",
|
||||
". c #fefefe",
|
||||
"# c #444444",
|
||||
@ -48,10 +64,28 @@ static const char *L_open_xpm[] = {
|
||||
"#....@....#",
|
||||
"#.........#",
|
||||
"#.........#",
|
||||
"###########"};
|
||||
"###########"
|
||||
#endif
|
||||
};
|
||||
static Fl_Pixmap L_openpixmap(L_open_xpm);
|
||||
|
||||
static const char *L_close_xpm[] = {
|
||||
#ifdef __APPLE__
|
||||
"11 11 2 1",
|
||||
". c None",
|
||||
"@ c #000000",
|
||||
"...........",
|
||||
"...........",
|
||||
"...........",
|
||||
"...........",
|
||||
"...........",
|
||||
"@@@@@@@@@@@",
|
||||
".@@@@@@@@@.",
|
||||
"..@@@@@@@..",
|
||||
"...@@@@@...",
|
||||
"....@@@....",
|
||||
".....@....."
|
||||
#else
|
||||
"11 11 3 1",
|
||||
". c #fefefe",
|
||||
"# c #444444",
|
||||
@ -66,7 +100,9 @@ static const char *L_close_xpm[] = {
|
||||
"#.........#",
|
||||
"#.........#",
|
||||
"#.........#",
|
||||
"###########"};
|
||||
"###########"
|
||||
#endif
|
||||
};
|
||||
static Fl_Pixmap L_closepixmap(L_close_xpm);
|
||||
|
||||
/// Sets the default icon to be used as the 'open' icon
|
||||
@ -105,7 +141,11 @@ Fl_Tree_Prefs::Fl_Tree_Prefs() {
|
||||
_selectcolor = FL_DARK_BLUE;
|
||||
_inactivecolor = FL_GRAY;
|
||||
_connectorcolor = Fl_Color(43);
|
||||
#ifdef __APPLE__
|
||||
_connectorstyle = FL_TREE_CONNECTOR_NONE;
|
||||
#else
|
||||
_connectorstyle = FL_TREE_CONNECTOR_DOTTED;
|
||||
#endif
|
||||
_openimage = &L_openpixmap;
|
||||
_closeimage = &L_closepixmap;
|
||||
_userimage = 0;
|
||||
|
||||
@ -92,7 +92,7 @@ const char *default_menu[] = {
|
||||
"@e:Block\\nAttack!:blocks\n",
|
||||
"@e:Checkers:checkers\n",
|
||||
"@e:Sudoku:sudoku\n",
|
||||
"@e:Print\nsupport:device\n",
|
||||
"@e:Print\\nsupport:device\n",
|
||||
"\n",
|
||||
"@main:Other\\nTests:@o\n",
|
||||
"@o:Color Choosers:color_chooser\n",
|
||||
|
||||
@ -218,6 +218,23 @@ Fl_Choice *collapseicons_chooser=(Fl_Choice *)0;
|
||||
|
||||
static void cb_collapseicons_chooser(Fl_Choice*, void*) {
|
||||
static const char *L_open_xpm[] = {
|
||||
#ifdef __APPLE__
|
||||
"11 11 3 1",
|
||||
". c #fefefe",
|
||||
"# c #444444",
|
||||
"@ c #000000",
|
||||
"###########",
|
||||
"#.........#",
|
||||
"#.........#",
|
||||
"#....@....#",
|
||||
"#....@....#",
|
||||
"#..@@@@@..#",
|
||||
"#....@....#",
|
||||
"#....@....#",
|
||||
"#.........#",
|
||||
"#.........#",
|
||||
"###########"
|
||||
#else
|
||||
"11 11 2 1",
|
||||
". c None",
|
||||
"@ c #000000",
|
||||
@ -231,10 +248,29 @@ static void cb_collapseicons_chooser(Fl_Choice*, void*) {
|
||||
"...@@@@....",
|
||||
"...@@@.....",
|
||||
"...@@......",
|
||||
"...@......."};
|
||||
"...@......."
|
||||
#endif
|
||||
};
|
||||
static Fl_Pixmap L_openpixmap(L_open_xpm);
|
||||
|
||||
static const char *L_close_xpm[] = {
|
||||
#ifdef __APPLE__
|
||||
"11 11 3 1",
|
||||
". c #fefefe",
|
||||
"# c #444444",
|
||||
"@ c #000000",
|
||||
"###########",
|
||||
"#.........#",
|
||||
"#.........#",
|
||||
"#.........#",
|
||||
"#.........#",
|
||||
"#..@@@@@..#",
|
||||
"#.........#",
|
||||
"#.........#",
|
||||
"#.........#",
|
||||
"#.........#",
|
||||
"###########"
|
||||
#else
|
||||
"11 11 2 1",
|
||||
". c None",
|
||||
"@ c #000000",
|
||||
@ -248,7 +284,9 @@ static const char *L_close_xpm[] = {
|
||||
"..@@@@@@@..",
|
||||
"...@@@@@...",
|
||||
"....@@@....",
|
||||
".....@....."};
|
||||
".....@....."
|
||||
#endif
|
||||
};
|
||||
static Fl_Pixmap L_closepixmap(L_close_xpm);
|
||||
|
||||
switch ( collapseicons_chooser->value() ) {
|
||||
@ -270,7 +308,7 @@ switch ( collapseicons_chooser->value() ) {
|
||||
|
||||
Fl_Menu_Item menu_collapseicons_chooser[] = {
|
||||
{"Normal", 0, 0, 0, 0, FL_NORMAL_LABEL, 0, 11, 0},
|
||||
{"Arrow", 0, 0, 0, 0, FL_NORMAL_LABEL, 0, 11, 0},
|
||||
{"Custom", 0, 0, 0, 0, FL_NORMAL_LABEL, 0, 11, 0},
|
||||
{"Off", 0, 0, 0, 0, FL_NORMAL_LABEL, 0, 11, 0},
|
||||
{0,0,0,0,0,0,0,0,0}
|
||||
};
|
||||
@ -519,6 +557,18 @@ static void cb_clearall_button(Fl_Button*, void*) {
|
||||
tree->redraw();
|
||||
}
|
||||
|
||||
Fl_Button *loaddb_button=(Fl_Button *)0;
|
||||
|
||||
static void cb_loaddb_button(Fl_Button*, void*) {
|
||||
const char *filename = fl_file_chooser("Select a Preferences style Databse", "Preferences(*.prefs)", 0L);
|
||||
if (filename) {
|
||||
tree->clear();
|
||||
Fl_Preferences prefs(filename, 0L, 0L);
|
||||
tree->load(prefs);
|
||||
tree->redraw();
|
||||
};
|
||||
}
|
||||
|
||||
int main(int argc, char **argv) {
|
||||
{ window = new Fl_Double_Window(580, 695, "tree");
|
||||
{ tree = new Fl_Tree(15, 15, 550, 390);
|
||||
@ -538,7 +588,6 @@ int main(int argc, char **argv) {
|
||||
margintop_slider->tooltip("Changes the top margin for the tree widget");
|
||||
margintop_slider->type(1);
|
||||
margintop_slider->labelsize(12);
|
||||
margintop_slider->step(0.01);
|
||||
margintop_slider->textsize(12);
|
||||
margintop_slider->callback((Fl_Callback*)cb_margintop_slider, (void*)(tree));
|
||||
margintop_slider->align(Fl_Align(FL_ALIGN_LEFT));
|
||||
@ -551,7 +600,6 @@ int main(int argc, char **argv) {
|
||||
marginleft_slider->tooltip("Changes the left margin for the tree widget");
|
||||
marginleft_slider->type(1);
|
||||
marginleft_slider->labelsize(12);
|
||||
marginleft_slider->step(0.01);
|
||||
marginleft_slider->textsize(12);
|
||||
marginleft_slider->callback((Fl_Callback*)cb_marginleft_slider, (void*)(tree));
|
||||
marginleft_slider->align(Fl_Align(FL_ALIGN_LEFT));
|
||||
@ -564,7 +612,6 @@ int main(int argc, char **argv) {
|
||||
openchild_marginbottom_slider->tooltip("Changes the vertical space below an open child tree");
|
||||
openchild_marginbottom_slider->type(1);
|
||||
openchild_marginbottom_slider->labelsize(12);
|
||||
openchild_marginbottom_slider->step(0.01);
|
||||
openchild_marginbottom_slider->textsize(12);
|
||||
openchild_marginbottom_slider->callback((Fl_Callback*)cb_openchild_marginbottom_slider, (void*)(tree));
|
||||
openchild_marginbottom_slider->align(Fl_Align(FL_ALIGN_LEFT));
|
||||
@ -578,7 +625,6 @@ int main(int argc, char **argv) {
|
||||
d");
|
||||
labelsize_slider->type(1);
|
||||
labelsize_slider->labelsize(12);
|
||||
labelsize_slider->step(0.01);
|
||||
labelsize_slider->textsize(12);
|
||||
labelsize_slider->callback((Fl_Callback*)cb_labelsize_slider, (void*)(tree));
|
||||
labelsize_slider->align(Fl_Align(FL_ALIGN_LEFT));
|
||||
@ -591,29 +637,28 @@ d");
|
||||
connectorwidth_slider->tooltip("Tests Fl_Tree::connectorwidth()");
|
||||
connectorwidth_slider->type(1);
|
||||
connectorwidth_slider->labelsize(12);
|
||||
connectorwidth_slider->step(0.01);
|
||||
connectorwidth_slider->textsize(12);
|
||||
connectorwidth_slider->callback((Fl_Callback*)cb_connectorwidth_slider, (void*)(tree));
|
||||
connectorwidth_slider->align(Fl_Align(FL_ALIGN_LEFT));
|
||||
o->value(tree->connectorwidth());
|
||||
o->range(10.0, 100.0);
|
||||
o->range(1.0, 100.0);
|
||||
o->step(1.0);
|
||||
o->color(46); o->selection_color(FL_RED);
|
||||
} // Fl_Value_Slider* connectorwidth_slider
|
||||
{ usericon_radio = new Fl_Check_Button(145, 520, 130, 16, "Enable user icons?");
|
||||
{ usericon_radio = new Fl_Check_Button(145, 525, 130, 16, "Enable user icons?");
|
||||
usericon_radio->tooltip("Tests Fl_Tree_Item::usericon()");
|
||||
usericon_radio->down_box(FL_DOWN_BOX);
|
||||
usericon_radio->labelsize(11);
|
||||
usericon_radio->callback((Fl_Callback*)cb_usericon_radio, (void*)(tree));
|
||||
} // Fl_Check_Button* usericon_radio
|
||||
{ showroot_radio = new Fl_Check_Button(145, 539, 130, 16, "Show root?");
|
||||
{ showroot_radio = new Fl_Check_Button(145, 544, 130, 16, "Show root?");
|
||||
showroot_radio->tooltip("Tests Fl_Tree_Item::usericon()");
|
||||
showroot_radio->down_box(FL_DOWN_BOX);
|
||||
showroot_radio->labelsize(11);
|
||||
showroot_radio->callback((Fl_Callback*)cb_showroot_radio, (void*)(tree));
|
||||
int onoff = tree->showroot(); showroot_radio->value(onoff);
|
||||
} // Fl_Check_Button* showroot_radio
|
||||
{ collapseicons_chooser = new Fl_Choice(145, 564, 110, 16, "Collapse icons");
|
||||
{ collapseicons_chooser = new Fl_Choice(145, 572, 110, 16, "Collapse icons");
|
||||
collapseicons_chooser->tooltip("Tests Fl_Tree::openicon() and Fl_Tree::closeicon()");
|
||||
collapseicons_chooser->down_box(FL_BORDER_BOX);
|
||||
collapseicons_chooser->labelsize(11);
|
||||
@ -621,16 +666,16 @@ d");
|
||||
collapseicons_chooser->callback((Fl_Callback*)cb_collapseicons_chooser);
|
||||
collapseicons_chooser->menu(menu_collapseicons_chooser);
|
||||
} // Fl_Choice* collapseicons_chooser
|
||||
{ connectorstyle_chooser = new Fl_Choice(145, 584, 110, 16, "Line style");
|
||||
{ connectorstyle_chooser = new Fl_Choice(145, 592, 110, 16, "Line style");
|
||||
connectorstyle_chooser->tooltip("Tests connectorstyle() bit flags");
|
||||
connectorstyle_chooser->down_box(FL_BORDER_BOX);
|
||||
connectorstyle_chooser->labelsize(11);
|
||||
connectorstyle_chooser->textsize(11);
|
||||
connectorstyle_chooser->callback((Fl_Callback*)cb_connectorstyle_chooser);
|
||||
connectorstyle_chooser->menu(menu_connectorstyle_chooser);
|
||||
connectorstyle_chooser->value(1); // tree's default is 'dotted'
|
||||
switch (tree->connectorstyle()) { case FL_TREE_CONNECTOR_NONE: connectorstyle_chooser->value(0); break; case FL_TREE_CONNECTOR_DOTTED: connectorstyle_chooser->value(1); break; case FL_TREE_CONNECTOR_SOLID: connectorstyle_chooser->value(2); break; }
|
||||
} // Fl_Choice* connectorstyle_chooser
|
||||
{ labelcolor_chooser = new Fl_Choice(145, 604, 110, 16, "Item Text Color");
|
||||
{ labelcolor_chooser = new Fl_Choice(145, 612, 110, 16, "Item Text Color");
|
||||
labelcolor_chooser->tooltip("Changes the label color for the selected items\nIf no items selected, all are\
|
||||
changed");
|
||||
labelcolor_chooser->down_box(FL_BORDER_BOX);
|
||||
@ -639,7 +684,7 @@ d");
|
||||
labelcolor_chooser->callback((Fl_Callback*)cb_labelcolor_chooser);
|
||||
labelcolor_chooser->menu(menu_labelcolor_chooser);
|
||||
} // Fl_Choice* labelcolor_chooser
|
||||
{ selectmode_chooser = new Fl_Choice(145, 624, 110, 16, "Selection Mode");
|
||||
{ selectmode_chooser = new Fl_Choice(145, 632, 110, 16, "Selection Mode");
|
||||
selectmode_chooser->tooltip("Sets how Fl_Tree handles mouse selection of tree items");
|
||||
selectmode_chooser->down_box(FL_BORDER_BOX);
|
||||
selectmode_chooser->labelsize(11);
|
||||
@ -649,7 +694,7 @@ d");
|
||||
selectmode_chooser->value(1);
|
||||
cb_selectmode_chooser(selectmode_chooser, (void*)0);
|
||||
} // Fl_Choice* selectmode_chooser
|
||||
{ whenmode_chooser = new Fl_Choice(145, 644, 110, 16, "When");
|
||||
{ whenmode_chooser = new Fl_Choice(145, 652, 110, 16, "When");
|
||||
whenmode_chooser->tooltip("Sets when() the tree\'s callback is invoked");
|
||||
whenmode_chooser->down_box(FL_BORDER_BOX);
|
||||
whenmode_chooser->labelsize(11);
|
||||
@ -688,37 +733,42 @@ d");
|
||||
bbbchild02select_toggle->labelsize(11);
|
||||
bbbchild02select_toggle->callback((Fl_Callback*)cb_bbbchild02select_toggle);
|
||||
} // Fl_Light_Button* bbbchild02select_toggle
|
||||
{ deactivate_toggle = new Fl_Light_Button(280, 625, 90, 16, " Deactivate");
|
||||
{ deactivate_toggle = new Fl_Light_Button(280, 633, 90, 16, " Deactivate");
|
||||
deactivate_toggle->tooltip("Toggle the deactivation state of the selected items.\nIf none are selected, a\
|
||||
ll are set.");
|
||||
deactivate_toggle->labelsize(11);
|
||||
deactivate_toggle->callback((Fl_Callback*)cb_deactivate_toggle);
|
||||
} // Fl_Light_Button* deactivate_toggle
|
||||
{ bold_toggle = new Fl_Light_Button(280, 644, 90, 16, " Bold Font");
|
||||
{ bold_toggle = new Fl_Light_Button(280, 652, 90, 16, " Bold Font");
|
||||
bold_toggle->tooltip("Toggles bold font for selected items\nIf nothing selected, all are changed");
|
||||
bold_toggle->labelsize(11);
|
||||
bold_toggle->callback((Fl_Callback*)cb_bold_toggle);
|
||||
} // Fl_Light_Button* bold_toggle
|
||||
{ insertabove_button = new Fl_Button(380, 624, 90, 16, "Insert Above");
|
||||
{ insertabove_button = new Fl_Button(380, 632, 90, 16, "Insert Above");
|
||||
insertabove_button->tooltip("Inserts three items above the selected items");
|
||||
insertabove_button->labelsize(11);
|
||||
insertabove_button->callback((Fl_Callback*)cb_insertabove_button);
|
||||
} // Fl_Button* insertabove_button
|
||||
{ rebuildtree_button = new Fl_Button(380, 644, 90, 16, "Rebuild Tree");
|
||||
{ rebuildtree_button = new Fl_Button(380, 652, 90, 16, "Rebuild Tree");
|
||||
rebuildtree_button->tooltip("Rebuilds the tree with defaults");
|
||||
rebuildtree_button->labelsize(11);
|
||||
rebuildtree_button->callback((Fl_Callback*)cb_rebuildtree_button);
|
||||
} // Fl_Button* rebuildtree_button
|
||||
{ clearselected_button = new Fl_Button(475, 624, 90, 16, "Clear Selected");
|
||||
{ clearselected_button = new Fl_Button(475, 632, 90, 16, "Clear Selected");
|
||||
clearselected_button->tooltip("Clears the selected items");
|
||||
clearselected_button->labelsize(11);
|
||||
clearselected_button->callback((Fl_Callback*)cb_clearselected_button);
|
||||
} // Fl_Button* clearselected_button
|
||||
{ clearall_button = new Fl_Button(475, 644, 90, 16, "Clear All");
|
||||
{ clearall_button = new Fl_Button(475, 652, 90, 16, "Clear All");
|
||||
clearall_button->tooltip("Clears all items\nTests Fl_Tree::clear()");
|
||||
clearall_button->labelsize(11);
|
||||
clearall_button->callback((Fl_Callback*)cb_clearall_button);
|
||||
} // Fl_Button* clearall_button
|
||||
{ loaddb_button = new Fl_Button(380, 612, 90, 16, "Load Database...");
|
||||
loaddb_button->tooltip("Load the contents of an Fl_Preferences databse into the tree view");
|
||||
loaddb_button->labelsize(11);
|
||||
loaddb_button->callback((Fl_Callback*)cb_loaddb_button);
|
||||
} // Fl_Button* loaddb_button
|
||||
window->end();
|
||||
} // Fl_Double_Window* window
|
||||
// Initialize Tree
|
||||
|
||||
107
test/tree.fl
107
test/tree.fl
@ -20,7 +20,13 @@ decl {\#include <FL/Fl_Tree.H>} {public global
|
||||
decl {\#include <FL/fl_ask.H>} {public global
|
||||
}
|
||||
|
||||
Function {Button_CB(Fl_Widget*w, void*data)} {open return_type void
|
||||
decl {\#include <FL/Fl_File_Chooser.H>} {selected public global
|
||||
}
|
||||
|
||||
decl {\#include <FL/Fl_Preferences.H>} {public global
|
||||
}
|
||||
|
||||
Function {Button_CB(Fl_Widget*w, void*data)} {return_type void
|
||||
} {
|
||||
code {fprintf(stderr, "'%s' button pushed\\n", w->label());} {}
|
||||
}
|
||||
@ -109,7 +115,7 @@ Function {} {open
|
||||
} {
|
||||
Fl_Window window {
|
||||
label tree open
|
||||
xywh {1105 30 580 695} type Double visible
|
||||
xywh {1105 44 580 695} type Double visible
|
||||
} {
|
||||
Fl_Group tree {
|
||||
user_data 1234
|
||||
@ -130,7 +136,7 @@ if ( item ) {
|
||||
callback {int val = (int)margintop_slider->value();
|
||||
tree->margintop(val);
|
||||
tree->redraw();}
|
||||
tooltip {Changes the top margin for the tree widget} xywh {190 414 240 16} type Horizontal labelsize 12 align 4 step 0.01 textsize 12
|
||||
tooltip {Changes the top margin for the tree widget} xywh {190 414 240 16} type Horizontal labelsize 12 align 4 textsize 12
|
||||
code0 {o->value(tree->margintop());}
|
||||
code1 {o->range(0.0, 100.0);}
|
||||
code2 {o->step(1.0);}
|
||||
@ -142,7 +148,7 @@ tree->redraw();}
|
||||
callback {int val = (int)marginleft_slider->value();
|
||||
tree->marginleft(val);
|
||||
tree->redraw();}
|
||||
tooltip {Changes the left margin for the tree widget} xywh {190 434 240 16} type Horizontal labelsize 12 align 4 step 0.01 textsize 12
|
||||
tooltip {Changes the left margin for the tree widget} xywh {190 434 240 16} type Horizontal labelsize 12 align 4 textsize 12
|
||||
code0 {o->value(tree->marginleft());}
|
||||
code1 {o->range(0.0, 100.0);}
|
||||
code2 {o->step(1.0);}
|
||||
@ -154,7 +160,7 @@ tree->redraw();}
|
||||
callback {int val = (int)openchild_marginbottom_slider->value();
|
||||
tree->openchild_marginbottom(val);
|
||||
tree->redraw();}
|
||||
tooltip {Changes the vertical space below an open child tree} xywh {190 454 240 16} type Horizontal labelsize 12 align 4 step 0.01 textsize 12
|
||||
tooltip {Changes the vertical space below an open child tree} xywh {190 454 240 16} type Horizontal labelsize 12 align 4 textsize 12
|
||||
code0 {o->value(tree->openchild_marginbottom());}
|
||||
code1 {o->range(0.0, 100.0);}
|
||||
code2 {o->step(1.0);}
|
||||
@ -183,7 +189,7 @@ if ( ! count ) {
|
||||
|
||||
tree->redraw();}
|
||||
tooltip {Changes the font size of the selected items
|
||||
If none selected, all are changed} xywh {190 474 240 16} type Horizontal labelsize 12 align 4 step 0.01 textsize 12
|
||||
If none selected, all are changed} xywh {190 474 240 16} type Horizontal labelsize 12 align 4 textsize 12
|
||||
code0 {o->value(tree->labelsize());}
|
||||
code1 {o->range(5.0, 200.0);}
|
||||
code2 {o->step(1.0);}
|
||||
@ -193,9 +199,9 @@ If none selected, all are changed} xywh {190 474 240 16} type Horizontal labelsi
|
||||
label {Connector width}
|
||||
user_data tree
|
||||
callback {tree->connectorwidth((int)connectorwidth_slider->value());}
|
||||
tooltip {Tests Fl_Tree::connectorwidth()} xywh {190 494 240 16} type Horizontal labelsize 12 align 4 step 0.01 textsize 12
|
||||
tooltip {Tests Fl_Tree::connectorwidth()} xywh {190 494 240 16} type Horizontal labelsize 12 align 4 textsize 12
|
||||
code0 {o->value(tree->connectorwidth());}
|
||||
code1 {o->range(10.0, 100.0);}
|
||||
code1 {o->range(1.0, 100.0);}
|
||||
code2 {o->step(1.0);}
|
||||
code3 {o->color(46); o->selection_color(FL_RED);}
|
||||
}
|
||||
@ -250,19 +256,36 @@ if ( usericon_radio->value() ) {
|
||||
if ( ( i = tree->find_item("Bbb/bgb/222") ) != NULL ) i->usericon(0);
|
||||
if ( ( i = tree->find_item("Bbb/bgb/333") ) != NULL ) i->usericon(0);
|
||||
}}
|
||||
tooltip {Tests Fl_Tree_Item::usericon()} xywh {145 520 130 16} down_box DOWN_BOX labelsize 11
|
||||
tooltip {Tests Fl_Tree_Item::usericon()} xywh {145 525 130 16} down_box DOWN_BOX labelsize 11
|
||||
}
|
||||
Fl_Check_Button showroot_radio {
|
||||
label {Show root?}
|
||||
user_data tree
|
||||
callback {int onoff = showroot_radio->value();
|
||||
tree->showroot(onoff);}
|
||||
tooltip {Tests Fl_Tree_Item::usericon()} xywh {145 539 130 16} down_box DOWN_BOX labelsize 11
|
||||
tooltip {Tests Fl_Tree_Item::usericon()} xywh {145 544 130 16} down_box DOWN_BOX labelsize 11
|
||||
code0 {int onoff = tree->showroot(); showroot_radio->value(onoff);}
|
||||
}
|
||||
Fl_Choice collapseicons_chooser {
|
||||
label {Collapse icons}
|
||||
callback {static const char *L_open_xpm[] = {
|
||||
\#ifdef __APPLE__
|
||||
"11 11 3 1",
|
||||
". c \#fefefe",
|
||||
"\# c \#444444",
|
||||
"@ c \#000000",
|
||||
"\#\#\#\#\#\#\#\#\#\#\#",
|
||||
"\#.........\#",
|
||||
"\#.........\#",
|
||||
"\#....@....\#",
|
||||
"\#....@....\#",
|
||||
"\#..@@@@@..\#",
|
||||
"\#....@....\#",
|
||||
"\#....@....\#",
|
||||
"\#.........\#",
|
||||
"\#.........\#",
|
||||
"\#\#\#\#\#\#\#\#\#\#\#"
|
||||
\#else
|
||||
"11 11 2 1",
|
||||
". c None",
|
||||
"@ c \#000000",
|
||||
@ -276,10 +299,29 @@ tree->showroot(onoff);}
|
||||
"...@@@@....",
|
||||
"...@@@.....",
|
||||
"...@@......",
|
||||
"...@......."};
|
||||
"...@......."
|
||||
\#endif
|
||||
};
|
||||
static Fl_Pixmap L_openpixmap(L_open_xpm);
|
||||
|
||||
static const char *L_close_xpm[] = {
|
||||
\#ifdef __APPLE__
|
||||
"11 11 3 1",
|
||||
". c \#fefefe",
|
||||
"\# c \#444444",
|
||||
"@ c \#000000",
|
||||
"\#\#\#\#\#\#\#\#\#\#\#",
|
||||
"\#.........\#",
|
||||
"\#.........\#",
|
||||
"\#.........\#",
|
||||
"\#.........\#",
|
||||
"\#..@@@@@..\#",
|
||||
"\#.........\#",
|
||||
"\#.........\#",
|
||||
"\#.........\#",
|
||||
"\#.........\#",
|
||||
"\#\#\#\#\#\#\#\#\#\#\#"
|
||||
\#else
|
||||
"11 11 2 1",
|
||||
". c None",
|
||||
"@ c \#000000",
|
||||
@ -293,7 +335,9 @@ static const char *L_close_xpm[] = {
|
||||
"..@@@@@@@..",
|
||||
"...@@@@@...",
|
||||
"....@@@....",
|
||||
".....@....."};
|
||||
".....@....."
|
||||
\#endif
|
||||
};
|
||||
static Fl_Pixmap L_closepixmap(L_close_xpm);
|
||||
|
||||
switch ( collapseicons_chooser->value() ) {
|
||||
@ -311,14 +355,14 @@ switch ( collapseicons_chooser->value() ) {
|
||||
tree->showcollapse(0);
|
||||
break;
|
||||
}} open
|
||||
tooltip {Tests Fl_Tree::openicon() and Fl_Tree::closeicon()} xywh {145 564 110 16} down_box BORDER_BOX labelsize 11 textsize 11
|
||||
tooltip {Tests Fl_Tree::openicon() and Fl_Tree::closeicon()} xywh {145 572 110 16} down_box BORDER_BOX labelsize 11 textsize 11
|
||||
} {
|
||||
MenuItem {} {
|
||||
label Normal
|
||||
xywh {0 0 36 21} labelsize 11
|
||||
}
|
||||
MenuItem {} {
|
||||
label Arrow
|
||||
label Custom
|
||||
xywh {10 10 36 21} labelsize 11
|
||||
}
|
||||
MenuItem {} {
|
||||
@ -334,8 +378,8 @@ switch ( connectorstyle_chooser->value() ) {
|
||||
case 1: tree->connectorstyle(FL_TREE_CONNECTOR_DOTTED); break;
|
||||
case 2: tree->connectorstyle(FL_TREE_CONNECTOR_SOLID); break;
|
||||
}} open
|
||||
tooltip {Tests connectorstyle() bit flags} xywh {145 584 110 16} down_box BORDER_BOX labelsize 11 textsize 11
|
||||
code0 {connectorstyle_chooser->value(1); // tree's default is 'dotted'}
|
||||
tooltip {Tests connectorstyle() bit flags} xywh {145 592 110 16} down_box BORDER_BOX labelsize 11 textsize 11
|
||||
code0 {switch (tree->connectorstyle()) { case FL_TREE_CONNECTOR_NONE: connectorstyle_chooser->value(0); break; case FL_TREE_CONNECTOR_DOTTED: connectorstyle_chooser->value(1); break; case FL_TREE_CONNECTOR_SOLID: connectorstyle_chooser->value(2); break; }}
|
||||
} {
|
||||
MenuItem {} {
|
||||
label None
|
||||
@ -380,7 +424,7 @@ if ( ! count ) {
|
||||
|
||||
tree->redraw();} open
|
||||
tooltip {Changes the label color for the selected items
|
||||
If no items selected, all are changed} xywh {145 604 110 16} down_box BORDER_BOX labelsize 11 textsize 11
|
||||
If no items selected, all are changed} xywh {145 612 110 16} down_box BORDER_BOX labelsize 11 textsize 11
|
||||
} {
|
||||
MenuItem {} {
|
||||
label Black
|
||||
@ -408,7 +452,7 @@ switch ( selectmode_chooser->value() ) {
|
||||
case 2: tree->selectmode(FL_TREE_SELECT_MULTI); break; // Multi
|
||||
default: tree->selectmode(FL_TREE_SELECT_SINGLE); break; // Single
|
||||
}}
|
||||
tooltip {Sets how Fl_Tree handles mouse selection of tree items} xywh {145 624 110 16} down_box BORDER_BOX labelsize 11 textsize 11
|
||||
tooltip {Sets how Fl_Tree handles mouse selection of tree items} xywh {145 632 110 16} down_box BORDER_BOX labelsize 11 textsize 11
|
||||
code0 {selectmode_chooser->value(1);}
|
||||
code1 {cb_selectmode_chooser(selectmode_chooser, (void*)0);}
|
||||
} {
|
||||
@ -434,7 +478,7 @@ switch ( whenmode_chooser->value() ) {
|
||||
case 2: tree->when(FL_WHEN_NEVER); break;
|
||||
default: tree->when(FL_WHEN_RELEASE); break;
|
||||
}}
|
||||
tooltip {Sets when() the tree's callback is invoked} xywh {145 644 110 16} down_box BORDER_BOX labelsize 11 textsize 11
|
||||
tooltip {Sets when() the tree's callback is invoked} xywh {145 652 110 16} down_box BORDER_BOX labelsize 11 textsize 11
|
||||
code0 {whenmode_chooser->value(1);}
|
||||
code1 {cb_whenmode_chooser(whenmode_chooser, (void*)0);}
|
||||
} {
|
||||
@ -527,7 +571,7 @@ if ( count == 0 ) {
|
||||
|
||||
tree->redraw();}
|
||||
tooltip {Toggle the deactivation state of the selected items.
|
||||
If none are selected, all are set.} xywh {280 625 90 16} labelsize 11
|
||||
If none are selected, all are set.} xywh {280 633 90 16} labelsize 11
|
||||
}
|
||||
Fl_Light_Button bold_toggle {
|
||||
label { Bold Font}
|
||||
@ -551,7 +595,7 @@ if ( ! count ) {
|
||||
|
||||
tree->redraw();}
|
||||
tooltip {Toggles bold font for selected items
|
||||
If nothing selected, all are changed} xywh {280 644 90 16} labelsize 11
|
||||
If nothing selected, all are changed} xywh {280 652 90 16} labelsize 11
|
||||
}
|
||||
Fl_Button insertabove_button {
|
||||
label {Insert Above}
|
||||
@ -566,12 +610,12 @@ while (item) {
|
||||
}
|
||||
|
||||
tree->redraw();}
|
||||
tooltip {Inserts three items above the selected items} xywh {380 624 90 16} labelsize 11
|
||||
tooltip {Inserts three items above the selected items} xywh {380 632 90 16} labelsize 11
|
||||
}
|
||||
Fl_Button rebuildtree_button {
|
||||
label {Rebuild Tree}
|
||||
callback {RebuildTree();}
|
||||
tooltip {Rebuilds the tree with defaults} xywh {380 644 90 16} labelsize 11
|
||||
tooltip {Rebuilds the tree with defaults} xywh {380 652 90 16} labelsize 11
|
||||
}
|
||||
Fl_Button clearselected_button {
|
||||
label {Clear Selected}
|
||||
@ -586,14 +630,25 @@ while (item) {
|
||||
}
|
||||
|
||||
tree->redraw();}
|
||||
tooltip {Clears the selected items} xywh {475 624 90 16} labelsize 11
|
||||
tooltip {Clears the selected items} xywh {475 632 90 16} labelsize 11
|
||||
}
|
||||
Fl_Button clearall_button {
|
||||
label {Clear All}
|
||||
callback {tree->clear();
|
||||
tree->redraw();} selected
|
||||
tree->redraw();}
|
||||
tooltip {Clears all items
|
||||
Tests Fl_Tree::clear()} xywh {475 644 90 16} labelsize 11
|
||||
Tests Fl_Tree::clear()} xywh {475 652 90 16} labelsize 11
|
||||
}
|
||||
Fl_Button loaddb_button {
|
||||
label {Load Database...}
|
||||
callback {const char *filename = fl_file_chooser("Select a Preferences style Databse", "Preferences(*.prefs)", 0L);
|
||||
if (filename) {
|
||||
tree->clear();
|
||||
Fl_Preferences prefs(filename, 0L, 0L);
|
||||
tree->load(prefs);
|
||||
tree->redraw();
|
||||
}}
|
||||
tooltip {Load the contents of an Fl_Preferences databse into the tree view} xywh {380 612 90 16} labelsize 11
|
||||
}
|
||||
}
|
||||
code {// Initialize Tree
|
||||
|
||||
@ -9,6 +9,8 @@
|
||||
#include <FL/Fl_Group.H>
|
||||
#include <FL/Fl_Tree.H>
|
||||
#include <FL/fl_ask.H>
|
||||
#include <FL/Fl_File_Chooser.H>
|
||||
#include <FL/Fl_Preferences.H>
|
||||
void Button_CB(Fl_Widget*w, void*data);
|
||||
void RebuildTree();
|
||||
#include <FL/Fl_Double_Window.H>
|
||||
@ -44,6 +46,7 @@ extern Fl_Button *insertabove_button;
|
||||
extern Fl_Button *rebuildtree_button;
|
||||
extern Fl_Button *clearselected_button;
|
||||
extern Fl_Button *clearall_button;
|
||||
extern Fl_Button *loaddb_button;
|
||||
extern Fl_Menu_Item menu_collapseicons_chooser[];
|
||||
extern Fl_Menu_Item menu_connectorstyle_chooser[];
|
||||
extern Fl_Menu_Item menu_labelcolor_chooser[];
|
||||
|
||||
Loading…
Reference in New Issue
Block a user